CymitQuimica logo

CAS 38359-86-3

:

5,6,7,8-tetrahydro[1]benzothieno[2,3-d][1,2,3]triazin-4(3H)-one

Description:
5,6,7,8-tetrahydro[1]benzothieno[2,3-d][1,2,3]triazin-4(3H)-one, with the CAS number 38359-86-3, is a heterocyclic compound characterized by its complex fused ring structure, which includes a benzothieno moiety and a triazine ring. This compound typically exhibits properties associated with heterocycles, such as potential biological activity and solubility in organic solvents. The presence of nitrogen and sulfur atoms in its structure may contribute to its reactivity and interaction with biological systems. It may also display unique optical and electronic properties due to its conjugated system. Such compounds are often of interest in medicinal chemistry and materials science, where they can serve as precursors or active pharmaceutical ingredients. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, this compound represents a class of substances that can have diverse applications based on their structural features and chemical behavior.
Formula:C9H9N3OS
InChI:InChI=1/C9H9N3OS/c13-8-7-5-3-1-2-4-6(5)14-9(7)11-12-10-8/h1-4H2,(H,10,11,13)
SMILES:C1CCc2c(C1)c1c(nnnc1s2)O
Synonyms:
  • [1]benzothieno[2,3-d]-1,2,3-triazin-4(3H)-one, 5,6,7,8-tetrahydro-
  • [1]Benzothieno[2,3-D]-1,2,3-Triazin-4-Ol, 5,6,7,8-Tetrahydro-
  • 5,6,7,8-Tetrahydro[1]benzothieno[2,3-d][1,2,3]triazin-4(3H)-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.