CAS 383675-06-7

ethyl 5-aminobenzothiophene-2-carboxylate hydrochloride

Description:

Ethyl 5-aminobenzothiophene-2-carboxylate hydrochloride is a chemical compound characterized by its unique structure, which includes a benzothiophene core, an ethyl ester group, and an amino functional group. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the hydrochloride salt form. The presence of the amino group suggests potential basicity, while the carboxylate group contributes to its acidic properties. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its molecular structure allows for various chemical reactions, including substitution and coupling reactions, which can be exploited in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.

Formula: C₁₁H₁₂ClNO₂S

InChI: InChI=1/C11H11NO2S.ClH/c1-2-14-11(13)10-6-7-5-8(12)3-4-9(7)15-10;/h3-6H,2,12H2,1H3;1H

SMILES: CCOC(=O)c1cc2cc(ccc2s1)N.Cl

Synonyms:

• Ethyl-5-amino-1-benzothiophen-2-carboxylathydrochlorid(1:1)

Ethyl 5-amino-1-benzothiophene-2-carboxylate hydrochloride

CAS: 383675-06-7

Versatile small molecule scaffold

Formula: C₁₁H₁₂ClNO₂S

Purity: Min. 95%

Molecular weight: 257.74 g/mol

Ref: 3D-IQA67506