CAS 38373-46-5

5-Pyrimidinecarboxylic acid, 2-methoxy-, methyl ester

Description:

5-Pyrimidinecarboxylic acid, 2-methoxy-, methyl ester, with the CAS number 38373-46-5, is an organic compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a carboxylic acid functional group that is esterified with methanol, resulting in a methyl ester. The presence of the methoxy group at the 2-position of the pyrimidine ring contributes to its chemical reactivity and solubility properties. Typically, compounds like this exhibit moderate polarity, making them soluble in polar solvents such as methanol and ethanol, while being less soluble in non-polar solvents. The compound may be utilized in various applications, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its synthesis and reactivity can be influenced by the functional groups present, allowing for further derivatization in organic synthesis. Overall, this compound represents a versatile building block in organic chemistry.

Formula: C₇H₈N₂O₃

InChI: InChI=1S/C7H8N2O3/c1-11-6(10)5-3-8-7(12-2)9-4-5/h3-4H,1-2H3

InChI key: InChIKey=ODEORWXODGHOOJ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=NC(OC)=NC1

Methyl 2-methoxypyrimidine-5-carboxylate

CAS: 38373-46-5

Formula: C₇H₈N₂O₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 168.1500

Ref: IN-DA00CLI0

Methyl 2-methoxypyrimidine-5-carboxylate

CAS: 38373-46-5

Methyl 2-methoxypyrimidine-5-carboxylate

Purity: 96%

Molecular weight: 168.15g/mol

Ref: 54-OR78592

Methyl 2-methoxypyrimidine-5-carboxylate

CAS: 38373-46-5

Purity: 96%

Molecular weight: 168.1519928

Ref: 10-F633187