CAS 3839-22-3
:2-Cyanobenzoic Acid
Description:
2-Cyanobenzoic acid, also known as o-cyanobenzoic acid, is an aromatic compound characterized by the presence of both a cyano group (-CN) and a carboxylic acid group (-COOH) attached to a benzene ring. Its molecular formula is C8H6NO2, and it features a benzene ring with the cyano group positioned ortho to the carboxylic acid group. This compound is typically a white to light yellow solid and is soluble in polar organic solvents. It exhibits acidic properties due to the carboxylic acid group, allowing it to participate in various chemical reactions, including esterification and amidation. The cyano group contributes to its reactivity, making it useful in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, 2-cyanobenzoic acid can be utilized in the study of molecular interactions and as a building block in the synthesis of more complex organic molecules. Its unique functional groups also allow for potential applications in materials science and dye chemistry.
Formula:C8H4NO2
InChI:InChI=1/C8H5NO2/c9-5-6-3-1-2-4-7(6)8(10)11/h1-4H,(H,10,11)/p-1
SMILES:c1ccc(c(c1)C#N)C(=O)[O-]
Synonyms:- o-Cyanobenzoic acid
- 2-Cyanobenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2-Cyanobenzoic acid, 94%
CAS:2-Cyanobenzoic acid has been used as reactant in the synthesis of T-box riboswitch antiterminator RNA-binding oxazolidinone derivatives, Benzoate modified -cyclodextrin derivatives and Pyrrolo[1,2-f]triazines for use as JAK2 inhibitors. As a reactant involved in decarboxylation, decarboxylative halo
Formula:C8H4NO2Purity:94%Color and Shape:White to pale cream or pale grey, Crystals or powder or crystalline powderMolecular weight:146.132-Cyanobenzoic Acid
CAS:Formula:C8H5NO2Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:147.132-Cyanobenzoic acid
CAS:2-Cyanobenzoic acidPurity:98%Color and Shape:Off-White SolidMolecular weight:147.1308g/mol








