CAS 3839-35-8

Toluenesulfonicacidhexylester; 98%

Description:

Toluenesulfonic acid hexyl ester, with the CAS number 3839-35-8, is an organic compound characterized by its ester functional group derived from toluenesulfonic acid and hexanol. This compound typically appears as a colorless to pale yellow liquid and is known for its solubility in organic solvents, making it useful in various chemical applications. It exhibits properties such as moderate viscosity and a relatively low boiling point compared to larger molecular weight compounds. Toluenesulfonic acid hexyl ester is often utilized as a reagent or catalyst in organic synthesis, particularly in reactions involving esterification and acylation. Additionally, it may serve as a surfactant or additive in formulations, enhancing the solubility and stability of other components. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may cause irritation upon contact with skin or eyes. Overall, its chemical stability and reactivity make it a valuable compound in both industrial and laboratory settings.

Formula: C₁₃H₂₀O₃S

InChI: InChI=1/C13H20O3S/c1-3-4-5-6-11-16-17(14,15)13-9-7-12(2)8-10-13/h7-10H,3-6,11H2,1-2H3

SMILES: CCCCCCOS(=O)(=O)c1ccc(C)cc1

Synonyms:

• p-Toluenesulfonic acid n-hexyl ester
• Hexyl 4-Methylbenzenesulfonate

Hexyl p-Toluenesulfonate

CAS: 3839-35-8

Formula: C₁₃H₂₀O₃S

Purity: >98.0%(GC)

Color and Shape: Colorless to Light yellow to Light orange clear liquid

Molecular weight: 256.36

Ref: 3B-T0883

Hexyl 4-methylbenzenesulfonate

CAS: 3839-35-8

Formula: C₁₃H₂₀O₃S

Purity: 95%

Color and Shape: Liquid

Molecular weight: 256.3611

Ref: IN-DA003U10

Hexyl P-Toluenesulfonate

CAS: 3839-35-8

Hexyl P-Toluenesulfonate

Purity: 99%

Molecular weight: 256.36g/mol

Ref: 54-OR1028336

Hexyl p-Toluenesulfonate

CAS: 3839-35-8

Formula: C₁₃H₂₀O₃S

Purity: 95%

Molecular weight: 256.36

Ref: 10-F546250