CAS 383902-28-1

4-bromo-2-{[(1-methyl-1H-benzimidazol-2-yl)amino]methyl}phenol

Description:

4-Bromo-2-{[(1-methyl-1H-benzimidazol-2-yl)amino]methyl}phenol is a chemical compound characterized by its complex structure, which includes a bromine atom, a phenolic group, and a benzimidazole moiety. The presence of the bromine substituent typically enhances the compound's reactivity and may influence its biological activity. The benzimidazole ring is known for its role in various pharmacological applications, often exhibiting antimicrobial and antifungal properties. The amino group linked to the benzimidazole suggests potential for hydrogen bonding, which can affect solubility and interaction with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its molecular structure indicates potential for diverse applications, including in drug design and synthesis. As with many organic compounds, the specific properties such as solubility, melting point, and stability can vary based on environmental conditions and the presence of other substances. Safety and handling precautions should be observed due to the presence of bromine and the potential biological activity of the compound.

Formula: C₁₅H₁₄BrN₃O

InChI: InChI=1/C15H14BrN3O/c1-19-13-5-3-2-4-12(13)18-15(19)17-9-10-8-11(16)6-7-14(10)20/h2-8,20H,9H2,1H3,(H,17,18)

SMILES: Cn1c2ccccc2[nH]c1=NCc1cc(ccc1O)Br

Synonyms:

• Phenol, 4-bromo-2-[[(1-methyl-1H-benzimidazol-2-yl)amino]methyl]-
• 4-Bromo-2-{[(1-methyl-1H-benzimidazol-2-yl)amino]methyl}phenol

4-bromo-2-{[(1-methyl-1H-benzimidazol-2-yl)amino]methyl}phenol

CAS: 383902-28-1

Purity: 95.0%

Molecular weight: 332.20098876953125

Ref: 10-F314989