CAS 383905-60-0
:(2S,3S,4S,5S,6S)-4-benzyloxy-2-(hydroxymethyl)-6-(4-methoxyphenoxy)tetrahydropyran-3,5-diol
Description:
The chemical substance known as "(2S,3S,4S,5S,6S)-4-benzyloxy-2-(hydroxymethyl)-6-(4-methoxyphenoxy)tetrahydropyran-3,5-diol" with CAS number 383905-60-0 is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple stereocenters, contributing to its specific three-dimensional configuration, which is crucial for its biological activity. The presence of hydroxymethyl and benzyloxy groups indicates potential for hydrogen bonding and hydrophobic interactions, influencing its solubility and reactivity. Additionally, the 4-methoxyphenoxy substituent enhances its lipophilicity, which may affect its pharmacokinetic properties. The compound's diol functionality suggests it can participate in various chemical reactions, including oxidation and esterification. Overall, this substance may exhibit interesting biological properties, making it a candidate for further research in medicinal chemistry and drug development. Its structural complexity and functional groups provide a foundation for diverse applications in synthetic organic chemistry.
Formula:C20H24O7
InChI:InChI=1/C20H24O7/c1-24-14-7-9-15(10-8-14)26-20-18(23)19(17(22)16(11-21)27-20)25-12-13-5-3-2-4-6-13/h2-10,16-23H,11-12H2,1H3/t16-,17-,18-,19-,20+/m0/s1
Synonyms:- 4-Methoxyphenyl 3-O-benzyl-α-L-allopyranoside
- α-L-allopyranoside, 4-methoxyphenyl 3-O-(phenylmethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Methoxyphenyl 3-O-Benzyl-β-D-galactopyranoside
CAS:Formula:C20H24O7Purity:98.0%Color and Shape:SolidMolecular weight:376.40044-Methoxyphenyl 3-O-Benzyl-β-D-galactopyranoside
CAS:4-Methoxyphenyl 3-O-Benzyl-β-D-galactopyranosidePurity:>98.0%4-Methoxyphenyl 3-O-Benzyl-β-D-galactopyranoside
CAS:Formula:C20H24O7Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:376.414-Methoxyphenyl 3-O-benzyl-β-D-galactopyranoside
CAS:4-Methoxyphenyl 3-O-benzyl-β-D-galactopyranoside is a microstructural stabilizer that can be used in the production of thermoelectric materials. It has been shown to inhibit the growth of bacteria and fungi at temperatures as low as −5°C. The compound has also been shown to have neuroprotective effects, which may be due to its ability to stabilize mitochondria and reduce oxidative stress. 4-Methoxyphenyl 3-O-benzyl-β-D-galactopyranoside is an endogenous ligand for unidentified receptors. It also binds to the amyloid protein in Alzheimer's disease, but does not show any significant toxicity in mice and rats.Formula:C20H24O7Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:376.4 g/mol




