CAS 383907-43-5

6-chloro-7-{[2-(morpholin-4-yl)ethyl]amino}quinoline-5,8-dione

Description:

6-Chloro-7-{[2-(morpholin-4-yl)ethyl]amino}quinoline-5,8-dione is a synthetic organic compound characterized by its complex structure, which includes a quinoline core substituted with a chlorine atom and a morpholine-containing side chain. This compound typically exhibits properties associated with quinoline derivatives, such as potential biological activity, including antimicrobial or anticancer effects, due to its ability to interact with various biological targets. The presence of the morpholine moiety may enhance its solubility and bioavailability, making it a candidate for pharmaceutical applications. Additionally, the compound's dione functional groups contribute to its reactivity and potential for forming coordination complexes with metal ions. Its molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, influencing its physical properties like melting point and solubility in different solvents. Overall, 6-chloro-7-{[2-(morpholin-4-yl)ethyl]amino}quinoline-5,8-dione represents a class of compounds with significant interest in medicinal chemistry and drug development.

Formula: C₁₅H₁₆ClN₃O₃

InChI: InChI=1/C15H16ClN3O3/c16-11-13(18-4-5-19-6-8-22-9-7-19)15(21)12-10(14(11)20)2-1-3-17-12/h1-3,18H,4-9H2

SMILES: c1cc2c(C(=O)C(=C(C2=O)Cl)NCCN2CCOCC2)nc1

Synonyms:

• 5,8-Quinolinedione, 6-chloro-7-[[2-(4-morpholinyl)ethyl]amino]-

NSC 663284

CAS: 383907-43-5

Formula: C₁₅H₁₆ClN₃O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 321.7588

Ref: IN-DA00C0BJ

DA-3003-1

CAS: 383907-43-5

DA-3003-1

Purity: ≥98%

Molecular weight: 321.76g/mol

Ref: 54-BUP21643

NSC 663284

CAS: 383907-43-5

Formula: C₁₅H₁₆ClN₃O₃

Purity: ≥ 98%

Color and Shape: Red powder

Molecular weight: 321.76

Ref: 7W-GL1467

DA-3003-1

CAS: 383907-43-5

DA-3003-1 (NSC 663284) is a Cdc25 dual specificity phosphatase inhibitor with antitumor activity and inhibits Cdc25B2, Cdc25A, Cdc25B2, and Cdc25C.

Formula: C₁₅H₁₆ClN₃O₃

Purity: 99.27% - 99.79%

Color and Shape: Solid

Molecular weight: 321.76

Ref: TM-T16357

NSC 663284

Controlled Product

CAS: 383907-43-5

Formula: C₁₅H₁₆ClN₃O₃

Color and Shape: Neat

Molecular weight: 321.759

Ref: TR-N900538