CAS 38399-13-2
:1,1'-ethyne-1,2-diylbis(2-bromobenzene)
Description:
1,1'-Ethyne-1,2-diylbis(2-bromobenzene), with the CAS number 38399-13-2, is an organic compound characterized by its unique structure that includes a central ethyne (acetylene) unit connected to two 2-bromobenzene groups. This compound features a linear arrangement due to the triple bond of the ethyne moiety, which contributes to its rigidity and potential for participating in various chemical reactions, such as cross-coupling reactions. The presence of bromine atoms on the benzene rings enhances its reactivity, making it a useful intermediate in organic synthesis. Additionally, the compound may exhibit interesting electronic properties due to the conjugation between the ethyne and the aromatic systems. Its physical properties, such as solubility and melting point, would depend on the specific interactions between the bromobenzene groups and the solvent used. Overall, this compound is of interest in materials science and organic synthesis, particularly in the development of functionalized polymers and advanced materials.
Formula:C14H8Br2
InChI:InChI=1/C14H8Br2/c15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)16/h1-8H
SMILES:c1ccc(c(c1)C#Cc1ccccc1Br)Br
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Bis(2-bromophenyl)acetylene
CAS:Formula:C14H8Br2Purity:>96.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:336.032,2'-Dibromodiphenylacetylene
CAS:2,2'-Dibromodiphenylacetylene (DBDP) is a biomolecular that belongs to the class of stilbene derivatives. It has been shown to have fluoro-transfer properties and can be used as a vapor transport or crystalline interaction. DBDP has been shown to produce diffraction with a shift angle of 8.6° in solution and yields of up to 98%. The steric effect was also observed when the molecule interacts with transfer and transistor molecules. DBDP has been shown to undergo an arylation reaction with phenanthridines, which are potent anti-inflammatory agents.Formula:C14H8Br2Color and Shape:PowderMolecular weight:336.02 g/mol



