CAS 38399-46-1
:4-Formyl-3-hydroxy-2-naphthoic acid
Description:
4-Formyl-3-hydroxy-2-naphthoic acid, with the CAS number 38399-46-1, is an organic compound characterized by its naphthalene structure, which features a hydroxyl group and an aldehyde functional group. This compound typically appears as a solid and is known for its potential applications in organic synthesis and as an intermediate in the production of dyes and pharmaceuticals. The presence of the hydroxyl group contributes to its solubility in polar solvents, while the naphthalene ring system provides stability and hydrophobic characteristics. The compound's reactivity is influenced by the aldehyde group, making it susceptible to nucleophilic attack and facilitating various chemical transformations. Additionally, 4-Formyl-3-hydroxy-2-naphthoic acid may exhibit biological activity, which could be of interest in medicinal chemistry. Its structural features allow for potential interactions with biological targets, making it a subject of research in the development of new therapeutic agents. Overall, this compound exemplifies the intersection of organic chemistry and potential practical applications in various fields.
Formula:C12H8O4
InChI:InChI=1/C12H8O4/c13-6-10-8-4-2-1-3-7(8)5-9(11(10)14)12(15)16/h1-6,14H,(H,15,16)
InChI key:InChIKey=LPRBZICETYEWOZ-UHFFFAOYSA-N
SMILES:C(=O)C=1C2=C(C=C(C(O)=O)C1O)C=CC=C2
Synonyms:- 2-Hydroxy-1-naphthaldehyde-3-carboxylic acid
- 2-Hydroxy-3-carboxy-1-naphthaldehyde
- 2-Naphthalenecarboxylic Acid, 4-Formyl-3-Hydroxy-
- 2-Naphthoic acid, 4-formyl-3-hydroxy-
- 3-Carboxy-2-hydroxy-1-naphthaldehyde
- 4-Formyl-3-hydroxy-2-naphthalenecarboxylic acid
- 4-Formyl-3-hydroxy-2-naphthoic acid
- 2-Hydroxy-3-carboxy-1-naphthaldehyd
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
4-Formyl-3-hydroxynaphthalene-2-carboxylic acid
CAS:4-Formyl-3-hydroxynaphthalene-2-carboxylic acid (4FHN) is an antibacterial agent. It is bacteriostatic and has been shown to be effective against gram-negative bacteria such as Escherichia coli and Pseudomonas aeruginosa, but not against gram-positive bacteria such as Staphylococcus aureus. 4FHN was found to inhibit the growth of both gram-positive and gram-negative bacteria by binding to the ribosomal RNA in the bacterial cell wall, thereby inhibiting protein synthesis and cell division. 4FHN also shows antimicrobial activity due to its ability to form stable hydrazones with nucleophilic centers in the bacterial cell wall. These compounds react with cellular macromolecules, leading to cell death.Formula:C12H8O4Purity:Min. 95%Molecular weight:216.19 g/mol
