CAS 384-54-3

2,3-Dichloro-1,1,1,4,4,4-hexafluorobutane

Description:

2,3-Dichloro-1,1,1,4,4,4-hexafluorobutane, with the CAS number 384-54-3, is a halogenated organic compound characterized by its unique structure that includes both chlorine and fluorine substituents on a butane backbone. This compound is typically a colorless liquid at room temperature and exhibits a relatively low boiling point compared to non-halogenated hydrocarbons. Its molecular structure contributes to its chemical stability and resistance to degradation, making it useful in various industrial applications, including as a solvent and in the production of specialty chemicals. The presence of multiple fluorine atoms imparts significant volatility and low surface tension, while the chlorine atoms enhance its reactivity in certain chemical processes. Additionally, 2,3-Dichloro-1,1,1,4,4,4-hexafluorobutane is subject to environmental regulations due to its potential impact on ozone depletion and greenhouse gas effects. Safety precautions are necessary when handling this compound, as it may pose health risks through inhalation or skin contact.

Formula: C₄H₂Cl₂F₆

InChI: InChI=1S/C4H2Cl2F6/c5-1(3(7,8)9)2(6)4(10,11)12/h1-2H

InChI key: InChIKey=DRNMSWBRUAIIJO-UHFFFAOYSA-N

SMILES: C(C(C(F)(F)F)Cl)(C(F)(F)F)Cl

Synonyms:

• Butane, 2,3-Dichloro-1,1,1,4,4,4-Hexafluoro-
• HCFC 336mdd
• Hcfc 336
• 2,3-Dichloro-1,1,1,4,4,4-hexafluorobutane

2,3-Dichloro-1,1,1,4,4,4-hexafluorobutane

CAS: 384-54-3

2,3-Dichloro-1,1,1,4,4,4-hexafluorobutane

Purity: 97%

Color and Shape: Clear Liquid

Molecular weight: 234.96g/mol

Ref: 54-PC3779