CymitQuimica logo

CAS 3840-66-2

:

2-chloro-N-[2-(4-chlorophenyl)ethyl]acetamide

Description:
2-Chloro-N-[2-(4-chlorophenyl)ethyl]acetamide, with the CAS number 3840-66-2, is a chemical compound that belongs to the class of acetamides. It features a chloro substituent and an ethyl group attached to a phenyl ring, contributing to its unique properties. This compound is characterized by its moderate polarity due to the presence of both the amide and chloro functional groups, which can influence its solubility in various solvents. The presence of the chlorophenyl moiety may impart specific biological activities, making it of interest in pharmaceutical research. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the chlorine substituents. Overall, 2-chloro-N-[2-(4-chlorophenyl)ethyl]acetamide is a compound of interest in both synthetic chemistry and medicinal chemistry, warranting further investigation into its properties and potential uses.
Formula:C10H11Cl2NO
InChI:InChI=1/C10H11Cl2NO/c11-7-10(14)13-6-5-8-1-3-9(12)4-2-8/h1-4H,5-7H2,(H,13,14)
SMILES:c1cc(ccc1CCN=C(CCl)O)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.