CAS 38401-67-1
:5-(4-Methoxyphenyl)thiophene-2-carboxaldehyde
Description:
5-(4-Methoxyphenyl)thiophene-2-carboxaldehyde is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. The presence of a carboxaldehyde functional group (-CHO) at the 2-position of the thiophene ring contributes to its reactivity, making it a potential candidate for various chemical reactions, including condensation and nucleophilic addition. The para-methoxyphenyl group at the 5-position enhances the compound's electron-donating properties, which can influence its electronic characteristics and reactivity. This compound is typically used in organic synthesis and may serve as an intermediate in the production of more complex molecules, including pharmaceuticals and agrochemicals. Its unique structure allows for potential applications in materials science, particularly in the development of organic semiconductors or dyes. Additionally, the presence of both aromatic and heteroaromatic components may impart interesting optical and electronic properties, making it a subject of interest in research and development within the fields of organic chemistry and materials science.
Formula:C12H10O2S
InChI:InChI=1/C12H10O2S/c1-14-10-4-2-9(3-5-10)12-7-6-11(8-13)15-12/h2-8H,1H3
SMILES:COc1ccc(cc1)c1ccc(C=O)s1
Synonyms:- 2-Thiophenecarboxaldehyde, 5-(4-methoxyphenyl)-
- 5-(4-Methoxyphenyl)thiophene-2-carbaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5-(4-Methoxyphenyl)thiophene-2-carboxaldehyde, 99%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C12H10O2SPurity:99%Color and Shape:White to pale brown, Crystals or crystalline powder or powder or solidMolecular weight:218.275-(4-Methoxyphenyl)thiophene-2-carbaldehyde
CAS:Formula:C12H10O2SPurity:98%Color and Shape:SolidMolecular weight:218.27165-(4-Methoxyphenyl)thiophene-2-carboxaldehyde
CAS:5-(4-Methoxyphenyl)thiophene-2-carboxaldehydePurity:≥95%


