CAS 38401-72-8

5-(3-Bromophenyl)-2-thiophenecarboxaldehyde

Description:

5-(3-Bromophenyl)-2-thiophenecarboxaldehyde is an organic compound characterized by the presence of both a thiophene ring and a bromophenyl group. The compound features a carboxaldehyde functional group, which is indicative of its reactivity and potential applications in organic synthesis. The bromine atom on the phenyl ring enhances the compound's electrophilicity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The thiophene moiety contributes to the compound's aromatic properties and can influence its electronic characteristics. This compound is typically utilized in the synthesis of more complex organic molecules and may have applications in materials science, pharmaceuticals, or agrochemicals. Its unique structure allows for potential interactions in biological systems, making it a candidate for further research in medicinal chemistry. As with many organic compounds, handling should be done with care, considering safety protocols due to the presence of bromine and the reactivity of the aldehyde group.

Formula: C₁₁H₇BrOS

InChI: InChI=1S/C11H7BrOS/c12-9-3-1-2-8(6-9)11-5-4-10(7-13)14-11/h1-7H

InChI key: InChIKey=XZSNNXGBKLEJKK-UHFFFAOYSA-N

SMILES: C(=O)C=1SC(=CC1)C2=CC(Br)=CC=C2

Synonyms:

• 5-(3-Bromophenyl)-2-thiophenecarboxaldehyde
• 2-Formyl-5-(3-bromophenyl)thiophene
• 2-Thiophenecarboxaldehyde, 5-(3-bromophenyl)-

5-(3-Bromo-phenyl)-thiophene-2-carbaldehyde

CAS: 38401-72-8

Versatile small molecule scaffold

Formula: C₁₁H₇BrOS

Purity: Min. 95%

Molecular weight: 267.14 g/mol

Ref: 3D-NBA40172