CAS 38404-42-1
:Benzoic acid, 3,4-dimethyl-, methyl ester
Description:
Benzoic acid, 3,4-dimethyl-, methyl ester, also known by its CAS number 38404-42-1, is an organic compound that belongs to the class of benzoate esters. It features a benzoic acid core with two methyl groups located at the 3 and 4 positions on the aromatic ring, and a methoxy group (-OCH3) attached to the carboxylic acid functional group, forming the ester. This compound is typically a colorless to pale yellow liquid with a characteristic sweet, fruity odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic aromatic structure. The presence of the methyl groups can influence its reactivity and physical properties, such as boiling and melting points. Benzoic acid derivatives, including this ester, are often used in the synthesis of various organic compounds, as well as in the fragrance and flavoring industries. Additionally, they may exhibit antimicrobial properties, making them of interest in food preservation and other applications.
Formula:C10H12O2
InChI:InChI=1S/C10H12O2/c1-7-4-5-9(6-8(7)2)10(11)12-3/h4-6H,1-3H3
InChI key:InChIKey=PTSSKYUSCIALKU-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(C)=C(C)C=C1
Synonyms:- Benzoic acid, 3,4-dimethyl-, methyl ester
- Methyl 3,4-dimethylbenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 3,4-dimethylbenzoate
CAS:Formula:C10H12O2Purity:98%Color and Shape:SolidMolecular weight:164.2011Methyl 3,4-dimethylbenzoate
CAS:Methyl 3,4-dimethylbenzoatePurity:≥95%Color and Shape:White SolidMolecular weight:164.20g/mol3,4-Dimethylbenzoic acid methyl ester
CAS:3,4-Dimethylbenzoic acid methyl ester (DMBME) is a photophysical agent that has a strong absorption in the visible region of the electromagnetic spectrum. DMBME is a difluoride compound that can be introduced as a reactant to control experiments for kinetic studies. When DMBME absorbs light, it undergoes an excited state reaction to form CO2 and water. The skeleton of this molecule is highly polar and hydrophilic, which allows it to dissolve in non-polar solvents. It also has two phenyl groups that are electron rich, making this compound suitable for gelation.Formula:C10H12O2Purity:Min. 95%Color and Shape:PowderMolecular weight:164.2 g/molMethyl 3,4-Dimethylbenzoate
CAS:Formula:C10H12O2Purity:97%Color and Shape:Solid, No data available.Molecular weight:164.204



