CAS 38422-62-7
:5-tert-Butyl-2-methyl-3-furoic acid
Description:
5-tert-Butyl-2-methyl-3-furoic acid is an organic compound characterized by its furoic acid structure, which includes a furan ring with a carboxylic acid functional group. This compound features a tert-butyl group and a methyl group at specific positions on the furan ring, contributing to its unique properties. It is typically a white to off-white solid at room temperature and is soluble in organic solvents, while its solubility in water is limited due to the hydrophobic nature of the tert-butyl group. The presence of the carboxylic acid group imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. This compound may be utilized in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Its specific reactivity and stability can be influenced by the steric hindrance introduced by the bulky tert-butyl group, making it an interesting subject for studies in medicinal chemistry and materials science.
Formula:C10H13O3
InChI:InChI=1/C10H14O3/c1-6-7(9(11)12)5-8(13-6)10(2,3)4/h5H,1-4H3,(H,11,12)/p-1
SMILES:Cc1c(cc(C(C)(C)C)o1)C(=O)[O-]
Synonyms:- 5-Tert-Butyl-2-Methylfuran-3-Carboxylic Acid
- 5-Tert-Butyl-2-Methylfuran-3-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-tert-Butyl-2-methyl-3-furoic acid, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C10H13O3Purity:97%Color and Shape:Cream, PowderMolecular weight:181.215-tert-Butyl-2-methylfuran-3-carboxylic acid
CAS:Formula:C10H14O3Color and Shape:SolidMolecular weight:182.21645-(tert-Butyl)-2-methyl-3-furoic acid
CAS:5-(tert-Butyl)-2-methyl-3-furoic acidFormula:C10H14O3Purity:≥95%Color and Shape: off-white powderMolecular weight:182.21635g/mol5-tert-Butyl-2-methylfuran-3-carboxylic acid
CAS:Formula:C10H14O3Purity:95.0%Color and Shape:Solid, Cream powderMolecular weight:182.2195-tert-Butyl-2-methyl-3-furoic acid
CAS:<p>Versatile small molecule scaffold</p>Formula:C10H14O3Purity:Min. 95%Molecular weight:182.22 g/mol




