CAS 38429-35-5
:(6R,7S)-7-{[(5R)-5-amino-5-carboxypentanoyl]amino}-3-[(carbamoyloxy)methyl]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
Description:
The chemical substance with the name "(6R,7S)-7-{[(5R)-5-amino-5-carboxypentanoyl]amino}-3-[(carbamoyloxy)methyl]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid" and CAS number "38429-35-5" is a complex organic compound characterized by its bicyclic structure, which includes a thiazolidine ring and an azabicyclo framework. This compound features multiple functional groups, including amino, carboxylic acid, and carbamoyloxy moieties, contributing to its potential biological activity. The presence of stereocenters indicates that it may exhibit chirality, which can influence its interactions in biological systems. Its structural complexity suggests that it may have applications in medicinal chemistry, possibly as an antibiotic or in other therapeutic areas. The specific arrangement of atoms and functional groups plays a crucial role in determining its reactivity, solubility, and overall pharmacological properties. Further studies would be necessary to elucidate its mechanism of action and potential uses in drug development.
Formula:C16H22N4O9S
InChI:InChI=1/C16H22N4O9S/c1-28-16(19-9(21)4-2-3-8(17)11(22)23)13(26)20-10(12(24)25)7(5-29-15(18)27)6-30-14(16)20/h8,14H,2-6,17H2,1H3,(H2,18,27)(H,19,21)(H,22,23)(H,24,25)/t8-,14-,16+/m1/s1
InChI key:InChIKey=LXWBXEWUSAABOA-UHFFFAOYSA-N
SMILES:N(C(CCCC(C(O)=O)N)=O)C1(OC)C2N(C1=O)C(C(O)=O)=C(COC(N)=O)CS2
Synonyms:- 38429-35-5
- 5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 3-[[(aminocarbonyl)oxy]methyl]-7-[(5-amino-5-carboxy-1-oxopentyl)amino]-7-methoxy-8-oxo-
- A 16886B
- A16886β
- (6R,7S)-7-{[(5R)-5-Amino-5-carboxypentanoyl]amino}-3-[(carbamoyloxy)methyl]-7-methoxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
- Cephamycin
- A16886B, A-16886B
- cephamycin C
- 5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 3-[[(aminocarbonyl)oxy]methyl]-7-[(5-amino-5-carboxy-1-oxopentyl)amino]-7-methoxy-8-oxo- (9CI)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Cephamycin C
CAS:Cephamycin C (CepC) is a nontoxic β-lactam antibiotic. CepC stands out from other cephalosporins for its greater resistance to β-lactamases.
Formula:C16H22N4O9SPurity:98%Color and Shape:SolidMolecular weight:446.43Ref: 4Z-C-156031
Discontinued productCephamycin C
CAS:Cephamycin C is a cephalosporin antibiotic, which is a type of β-lactam antibiotic. It is derived from the fermentation process of certain Streptomyces species and other actinomycetes. Its mode of action involves inhibiting bacterial cell wall synthesis by binding to penicillin-binding proteins (PBPs). This inhibition disrupts the structural integrity of the bacterial cell wall, leading to cell lysis and death.
Formula:C16H22N4O9SPurity:Min. 95%Color and Shape:PowderMolecular weight:446.4 g/molRef: 3D-AC09776
Discontinued product


