
CAS 3843-17-2
:Chromium(III) stearate
Description:
Chromium(III) stearate is a coordination compound formed from chromium in the +3 oxidation state and stearic acid, a long-chain fatty acid. It typically appears as a greenish or brownish powder and is insoluble in water but soluble in organic solvents. This compound is often used as a heat stabilizer and lubricant in various applications, including plastics and rubber. Its structure consists of chromium ions coordinated with stearate anions, which can influence its thermal stability and mechanical properties. Chromium(III) stearate is also noted for its potential use in catalysis and as a pigment in certain formulations. While chromium compounds can have environmental and health implications, Chromium(III) is generally considered less toxic than its hexavalent counterpart. However, safety precautions should still be observed when handling this substance, as with all chemical compounds. Proper storage in a cool, dry place away from incompatible materials is recommended to maintain its stability and effectiveness.
Formula:C18H36O2Cr
InChI:InChI=1S/C18H36O2.Cr/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2-17H2,1H3,(H,19,20);
InChI key:InChIKey=VOQOIPHDUOFMPA-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCC)CCCCCC(O)=O.[Cr]
Synonyms:- Chromic tristearate
- Stearic acid, chromium(3+) salt
- Octadecanoic acid, chromium(3+) salt (3:1)
- Chromium stearate (Cr(O2C18H35)3)
- Octadecanoic acid, chromium(3+) salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.