CAS 384342-65-8
:S-(1-Pyrenylmethyl) methanesulfonothioate
Description:
S-(1-Pyrenylmethyl) methanesulfonothioate is a chemical compound characterized by its unique structure, which includes a pyrenyl group attached to a methanesulfonothioate moiety. This compound features a sulfur atom bonded to both a methanesulfonyl group and a pyrenylmethyl group, contributing to its potential applications in various fields, including organic synthesis and materials science. The pyrenyl group, known for its fluorescent properties, can impart luminescent characteristics to the compound, making it useful in photonic applications. Additionally, the presence of the methanesulfonothioate functional group suggests potential reactivity in nucleophilic substitution reactions, which can be exploited in synthetic chemistry. The compound's solubility and stability in different solvents can vary, influencing its behavior in chemical reactions and applications. Overall, S-(1-Pyrenylmethyl) methanesulfonothioate represents an interesting compound for research and development due to its unique structural features and potential utility in various chemical contexts.
Formula:C18H14O2S2
InChI:InChI=1S/C18H14O2S2/c1-22(19,20)21-11-15-8-7-14-6-5-12-3-2-4-13-9-10-16(15)18(14)17(12)13/h2-10H,11H2,1H3
InChI key:InChIKey=OXKQGBUJTFUGBB-UHFFFAOYSA-N
SMILES:C(SS(C)(=O)=O)C1=C2C3=C4C(C=C2)=CC=CC4=CC=C3C=C1
Synonyms:- Methanesulfonothioic acid, S-(1-pyrenylmethyl) ester
- S-(1-Pyrenylmethyl) methanesulfonothioate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-Pyrenylmethyl Methanethiosulfonate
CAS:Formula:C18H14O2S2Color and Shape:SolidMolecular weight:326.43261-Pyrenylmethyl Methanethiosulfonate
CAS:Controlled ProductStability Light Sensitive, Moisture Sensitive
Applications A fluoresent compound used for the rapid and selective modification of sulfhydryl groups of enzymes.Fluorescence: max. Abs. 340nm; max. Em. 376nm; e x 10-3: 40
References Stauffer, D.A., and Karlin, A.: Biochemistry, 33, 6840 (1994), Yang, N. et al.: Neuron, 16, 113 (1996), Kuner, T. et al.: Neuron, 17, 343 (1996)Formula:C18H14O2S2Color and Shape:NeatMolecular weight:326.431-Pyrenylmethyl methanethiosulfonate
CAS:1-Pyrenylmethyl methanethiosulfonate is a chemical that is used as a building block in the synthesis of organic compounds. It is a useful intermediate in the synthesis of 1,2-dihydropyridines and 1,2-dihydropyrimidines. This compound has been shown to be useful in research into the development of new drugs. It can be used as a reagent for the determination of metals. 1-Pyrenylmethyl methanethiosulfonate can also be used as an indicator for metal ions due to its color change in the presence of these ions.Formula:C18H14O2S2Purity:Min. 95%Molecular weight:326.43 g/mol


