CAS 38440-79-8

2-deoxy-2-fluoro-D-mannose

Description:

2-Deoxy-2-fluoro-D-mannose is a fluorinated monosaccharide that is a derivative of mannose, a naturally occurring sugar. This compound features a fluorine atom substituted at the second carbon position, replacing a hydroxyl group found in D-mannose. The presence of the fluorine atom imparts unique chemical properties, such as increased stability and altered reactivity compared to its non-fluorinated counterpart. 2-Deoxy-2-fluoro-D-mannose is of interest in various fields, including medicinal chemistry and biochemistry, due to its potential applications in drug development and as a tool for studying carbohydrate metabolism. Its structural modifications can influence biological interactions, making it a valuable compound for research into glycosylation processes and enzyme activity. Additionally, the compound's solubility and reactivity can vary based on the surrounding conditions, such as pH and solvent polarity. Overall, 2-deoxy-2-fluoro-D-mannose represents a significant modification of a common sugar, providing insights into the role of fluorinated compounds in biological systems.

Formula: C₆H₁₁FO₅

InChI: InChI=1/C6H11FO5/c7-3(1-8)5(11)6(12)4(10)2-9/h1,3-6,9-12H,2H2/t3-,4-,5-,6-/m1/s1

SMILES: C(=O)[C@H]([C@H]([C@@H]([C@@H](CO)O)O)O)F

Synonyms:

• 2-DEOXY-2-FLUORO-α-D-MANNOSE
• 2-DEOXY-2-FLUORO-β-D-MANNOSE
• 2-Fluoro-2-deoxy-D-mannose
• D-mannose, 2-deoxy-2-fluoro-

2-Deoxy-2-fluoro-D-mannose

CAS: 38440-79-8

Molecular weight: 182.1

Ref: 7W-GC8511

2-Deoxy-2-fluoro-D-mannose

Controlled Product

CAS: 38440-79-8

Stability Very Hygroscopic
Applications 2-Deoxy-2-fluoro-D-mannose (cas# 38440-79-8) is a compound useful in organic synthesis.

Formula: C₆H₁₁FO₅

Color and Shape: Neat

Molecular weight: 182.15

Ref: TR-D235150

2-Deoxy-2-fluoro-D-mannose

CAS: 38440-79-8

2-Deoxy-2-fluoro-D-mannose is known for its antiviral properties as a sugar analog and glycosylation inhibitor. It works by inhibiting the glycosylation of viral envelope proteins, which can prevent viral replication and reduce viral infectivity. Studies have shown that 2-deoxy-2-fluoro-D-mannose can inhibit the replication of various viruses, including influenza A virus, human immunodeficiency virus (HIV), and hepatitis C virus (HCV). Inhibition of viral glycosylation by 2-Deoxy-2-fluoro-D-mannose can also enhance the effectiveness of some antiviral drugs, making them more potent.

Formula: C₆H₁₁FO₅

Purity: Min. 97 Area-%

Color and Shape: Powder

Molecular weight: 182.15 g/mol

Ref: 3D-MD03540

2-Deoxy-2-fluoro-D-mannose

CAS: 38440-79-8

Formula: C₆H₁₁FO₅

Purity: 98.0%

Molecular weight: 182.147

Ref: 10-F494204