CAS 38451-63-7

(4aS,8aS)-1,5,5,7,9,9-hexamethoxy-3,8a-diprop-2-en-1-yl-1,4a,5,8a-tetrahydro-1,4-ethanonaphthalene-6,10(4H)-dione

Description:

The chemical substance with the name "(4aS,8aS)-1,5,5,7,9,9-hexamethoxy-3,8a-diprop-2-en-1-yl-1,4a,5,8a-tetrahydro-1,4-ethanonaphthalene-6,10(4H)-dione" and CAS number "38451-63-7" is a complex organic compound characterized by its unique structural features, including multiple methoxy groups and a tetrahydro-naphthalene framework. This compound exhibits a specific stereochemistry, indicated by the (4aS,8aS) configuration, which suggests that it has chiral centers that can influence its biological activity and interactions. The presence of the hexamethoxy substituents enhances its solubility and may contribute to its reactivity and potential applications in various fields, such as pharmaceuticals or materials science. Additionally, the compound's dione functionality indicates the presence of two carbonyl groups, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. Overall, this substance represents a fascinating example of synthetic organic chemistry with potential implications in medicinal chemistry and other applications.

Formula: C₂₄H₃₂O₈

InChI: InChI=1/C24H32O8/c1-9-11-15-13-22(28-4)20(26)23(29-5,30-6)17(15)18-21(22,12-10-2)14-16(27-3)19(25)24(18,31-7)32-8/h9-10,13-14,17-18H,1-2,11-12H2,3-8H3/t17?,18-,21-,22?/m0/s1

SMILES: C=CCC1=CC2(C(=O)C(C1[C@H]1[C@]2(CC=C)C=C(C(=O)C1(OC)OC)OC)(OC)OC)OC

Asatone

CAS: 38451-63-7

Asatone from Radix et Rhizoma Asari has anti-inflammatory properties, acting on NF-κB and suppressing p-MAPK pathways (ERK, JNK, p38).

Formula: C₂₄H₃₂O₈

Purity: 99.84% - 99.92%

Color and Shape: Solid

Molecular weight: 448.51

Ref: TM-T10383

Asatone

CAS: 38451-63-7

Formula: C₂₄H₃₂O₈

Purity: 98.0%

Molecular weight: 448.5061

Ref: IN-DA00CPVE

Asatone

CAS: 38451-63-7

Asatone

Purity: ≥98%

Molecular weight: 448.51g/mol

Ref: 54-BUP07006

Asatone

CAS: 38451-63-7

Formula: C₂₄H₃₂O₈

Molecular weight: 448.51

Ref: 7W-GY7432

Asatone A

CAS: 38451-63-7

Formula: C₂₄H₃₂O₈

Purity: 95%~99%

Molecular weight: 448.512

Ref: BP-BP4105

Asatone

CAS: 38451-63-7

Asatone is a synthetic compound, categorized within a class of specialized chemical analogs, which is derived from intricate organic synthesis techniques. Its origin lies in a complex multi-step chemical process that involves the manipulation of reactive intermediates under controlled conditions to yield the desired molecular structure.

Formula: C₂₄H₃₂O₈

Purity: Min. 95%

Molecular weight: 448.51 g/mol

Ref: 3D-XA172998