CAS 38458-58-1

2-Butenoic acid, 4-hydroxy-2-(hydroxymethyl)-, (3aR,4R,6E,9S,10Z,11aR)-9-(acetyloxy)-2,3,3a,4,5,8,9,11a-octahydro-6,10-dimethyl-3-methylene-2-oxocyclodeca[b]furan-4-yl ester, (2E)-

Description:

2-Butenoic acid, 4-hydroxy-2-(hydroxymethyl)-, with the specified structure and CAS number 38458-58-1, is a complex organic compound characterized by its multi-functional groups and stereochemistry. This substance features a cyclodecafuran core, which contributes to its unique cyclic structure, along with multiple chiral centers that influence its stereochemical properties. The presence of hydroxyl groups indicates potential for hydrogen bonding, which can affect its solubility and reactivity. The acetyloxy group suggests that it may participate in esterification reactions, while the methylene and methyl groups contribute to its hydrophobic characteristics. The compound's structural complexity may result in interesting biological activities, making it a candidate for further research in medicinal chemistry or natural product synthesis. Its specific stereochemistry, denoted by the (3aR,4R,6E,9S,10Z,11aR) configuration, is crucial for determining its interactions with biological systems. Overall, this compound exemplifies the intricate nature of organic molecules and their potential applications in various fields.

Formula: C₂₂H₂₈O₈

InChI: InChI=1S/C22H28O8/c1-12-5-6-17(28-15(4)25)13(2)10-19-20(14(3)21(26)29-19)18(9-12)30-22(27)16(11-24)7-8-23/h5,7,10,17-20,23-24H,3,6,8-9,11H2,1-2,4H3/b12-5+,13-10-,16-7+/t17-,18+,19+,20+/m0/s1

InChI key: InChIKey=XYPJAWWDSQFSQA-RTZOPMFNSA-N

SMILES: O(C(/C(=C/CO)/CO)=O)[C@H]1[C@@]2([C@@](/C=C(/C)\[C@@H](OC(C)=O)C/C=C(\C)/C1)(OC(=O)C2=C)[H])[H]

Synonyms:

• Cyclodeca[b]furan, 2-butenoic acid deriv.
• Eucannabinolid
• 2-Butenoic acid, 4-hydroxy-2-(hydroxymethyl)-, 9-(acetyloxy)-2,3,3a,4,5,8,9,11a-octahydro-6,10-dimethyl-3-methylene-2-oxocyclodeca[b]furan-4-yl ester, [3aR-[3aR*,4R*(E),6E,9S*,10Z,11aR*]]-
• Eucannabinolide
• 2-Butenoic acid, 4-hydroxy-2-(hydroxymethyl)-, (3aR,4R,6E,9S,10Z,11aR)-9-(acetyloxy)-2,3,3a,4,5,8,9,11a-octahydro-6,10-dimethyl-3-methylene-2-oxocyclodeca[b]furan-4-yl ester, (2E)-

Eucannabinolide

CAS: 38458-58-1

Eucannabinolide exhibits in vivo antileukemic activity.

Formula: C₂₂H₂₈O₈

Purity: 98%

Color and Shape: Solid

Molecular weight: 420.45

Ref: TM-TN4027

Eucannabinolide

CAS: 38458-58-1

Formula: C₂₂H₂₈O₈

Purity: 95%~99%

Molecular weight: 420.458

Ref: BP-SBP04227

Eucannabinolide

CAS: 38458-58-1

Eucannabinolide is a sesquiterpene lactone, which is a naturally occurring compound that belongs to a diverse class of terpenoids. It is primarily sourced from the plant Vernonia amygdalina, which is commonly found in various parts of Africa and is known for its traditional medicinal uses. The mode of action of eucannabinolide is primarily associated with its cytotoxic properties, which have been shown to interact with cellular pathways that lead to the induction of apoptosis in certain cancer cells. This is achieved through the modulation of specific signaling pathways that regulate cell survival and death.

Formula: C₂₂H₂₈O₈

Purity: Min. 95%

Molecular weight: 420.5 g/mol

Ref: 3D-NBA45858

(E)-4-Hydroxy-2-hydroxymethyl-2-butenoic acid (3aR,4R,6E,9S,10Z,11aR)-9-acetoxy-2,3,3a,4,5,8,9,11a-octahydro-6,10-dimethyl-3-methylene-2-oxocyclodeca[b]furan-4-yl ester

CAS: 38458-58-1

Formula: C₂₂H₂₈O₈

Molecular weight: 420.4529

Ref: IN-DA00CN0X