CAS 38458-58-1
:2-Butenoic acid, 4-hydroxy-2-(hydroxymethyl)-, (3aR,4R,6E,9S,10Z,11aR)-9-(acetyloxy)-2,3,3a,4,5,8,9,11a-octahydro-6,10-dimethyl-3-methylene-2-oxocyclodeca[b]furan-4-yl ester, (2E)-
Description:
2-Butenoic acid, 4-hydroxy-2-(hydroxymethyl)-, with the specified structure and CAS number 38458-58-1, is a complex organic compound characterized by its multi-functional groups and stereochemistry. This substance features a cyclodecafuran core, which contributes to its unique cyclic structure, along with multiple chiral centers that influence its stereochemical properties. The presence of hydroxyl groups indicates potential for hydrogen bonding, which can affect its solubility and reactivity. The acetyloxy group suggests that it may participate in esterification reactions, while the methylene and methyl groups contribute to its hydrophobic characteristics. The compound's structural complexity may result in interesting biological activities, making it a candidate for further research in medicinal chemistry or natural product synthesis. Its specific stereochemistry, denoted by the (3aR,4R,6E,9S,10Z,11aR) configuration, is crucial for determining its interactions with biological systems. Overall, this compound exemplifies the intricate nature of organic molecules and their potential applications in various fields.
Formula:C22H28O8
InChI:InChI=1S/C22H28O8/c1-12-5-6-17(28-15(4)25)13(2)10-19-20(14(3)21(26)29-19)18(9-12)30-22(27)16(11-24)7-8-23/h5,7,10,17-20,23-24H,3,6,8-9,11H2,1-2,4H3/b12-5+,13-10-,16-7+/t17-,18+,19+,20+/m0/s1
InChI key:InChIKey=XYPJAWWDSQFSQA-RTZOPMFNSA-N
SMILES:O(C(/C(=C/CO)/CO)=O)[C@H]1[C@@]2([C@@](/C=C(/C)\[C@@H](OC(C)=O)C/C=C(\C)/C1)(OC(=O)C2=C)[H])[H]
Synonyms:- Cyclodeca[b]furan, 2-butenoic acid deriv.
- Eucannabinolid
- 2-Butenoic acid, 4-hydroxy-2-(hydroxymethyl)-, 9-(acetyloxy)-2,3,3a,4,5,8,9,11a-octahydro-6,10-dimethyl-3-methylene-2-oxocyclodeca[b]furan-4-yl ester, [3aR-[3aR*,4R*(E),6E,9S*,10Z,11aR*]]-
- Eucannabinolide
- 2-Butenoic acid, 4-hydroxy-2-(hydroxymethyl)-, (3aR,4R,6E,9S,10Z,11aR)-9-(acetyloxy)-2,3,3a,4,5,8,9,11a-octahydro-6,10-dimethyl-3-methylene-2-oxocyclodeca[b]furan-4-yl ester, (2E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Eucannabinolide
CAS:Eucannabinolide exhibits in vivo antileukemic activity.Formula:C22H28O8Purity:98%Color and Shape:SolidMolecular weight:420.45Eucannabinolide
CAS:Eucannabinolide is a sesquiterpene lactone, which is a naturally occurring compound that belongs to a diverse class of terpenoids. It is primarily sourced from the plant Vernonia amygdalina, which is commonly found in various parts of Africa and is known for its traditional medicinal uses. The mode of action of eucannabinolide is primarily associated with its cytotoxic properties, which have been shown to interact with cellular pathways that lead to the induction of apoptosis in certain cancer cells. This is achieved through the modulation of specific signaling pathways that regulate cell survival and death.Formula:C22H28O8Purity:Min. 95%Molecular weight:420.5 g/mol(E)-4-Hydroxy-2-hydroxymethyl-2-butenoic acid (3aR,4R,6E,9S,10Z,11aR)-9-acetoxy-2,3,3a,4,5,8,9,11a-octahydro-6,10-dimethyl-3-methylene-2-oxocyclodeca[b]furan-4-yl ester
CAS:Formula:C22H28O8Molecular weight:420.4529



