CAS 38464-04-9
:3,4-Diethoxybenzeneacetic acid
Description:
3,4-Diethoxybenzeneacetic acid, identified by its CAS number 38464-04-9, is an organic compound characterized by the presence of a benzene ring substituted with two ethoxy groups and an acetic acid moiety. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the ethoxy groups. The presence of the carboxylic acid functional group contributes to its acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the ethoxy substituents can influence the compound's reactivity and polarity, making it of interest in synthetic organic chemistry and potential applications in pharmaceuticals or agrochemicals. Its structural features may also impart specific biological activities, warranting further investigation into its potential uses in medicinal chemistry. As with many organic compounds, safety data should be consulted to ensure proper handling and usage.
Formula:C12H16O4
InChI:InChI=1S/C12H16O4/c1-3-15-10-6-5-9(8-12(13)14)7-11(10)16-4-2/h5-7H,3-4,8H2,1-2H3,(H,13,14)
InChI key:InChIKey=FIKUHWAANCXBGJ-UHFFFAOYSA-N
SMILES:O(CC)C1=C(OCC)C=CC(CC(O)=O)=C1
Synonyms:- 2-(3,4-Diethoxyphenyl)acetic acid
- 3,4-Diethoxy Phenyl Acetic Acid
- 3,4-Diethoxybenzeneacetic acid
- 3,4-Diethyloxy Phenyl acetic acid
- Acetic acid, (3,4-diethoxyphenyl)-
- Benzeneacetic acid, 3,4-diethoxy-
- 3,4-Diethoxyphenylacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,4-Diethoxyphenylacetic Acid
CAS:Formula:C12H16O4Purity:>98.0%(GC)(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:224.262-(3,4-Diethoxyphenyl)acetic acid
CAS:Formula:C12H16O4Purity:%Color and Shape:SolidMolecular weight:224.25302-(3,4-Diethoxyphenyl)acetic acid
CAS:2-(3,4-Diethoxyphenyl)acetic acidPurity:98%Molecular weight:224.26g/mol3,4-Diethoxyphenylacetic acid
CAS:<p>3,4-Diethoxyphenylacetic acid is a synthetic compound that has been shown to be an inhibitor of multidrug resistance (MDR) efflux pumps. It is also a substrate for membrane sulfotransferases, which are enzymes that catalyze the transfer of sulfate from 3,4-diethoxyphenylacetic acid to other compounds. The addition of 3,4-diethoxyphenylacetic acid to cultured human cells has been shown to inhibit the activity of p-glycoprotein and therefore increase the uptake of drugs such as acetonitrile and aluminium.</p>Formula:C12H16O4Purity:Min. 95%Color and Shape:PowderMolecular weight:224.25 g/mol(3,4-Diethoxy-phenyl)-acetic acid
CAS:Formula:C12H16O4Purity:≥98%Color and Shape:SolidMolecular weight:224.256




