CAS 38464-04-9: 3,4-Diethoxybenzeneacetic acid

Description:3,4-Diethoxybenzeneacetic acid, identified by its CAS number 38464-04-9, is an organic compound characterized by the presence of a benzene ring substituted with two ethoxy groups and an acetic acid moiety. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the ethoxy groups. The presence of the carboxylic acid functional group contributes to its acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the ethoxy substituents can influence the compound's reactivity and polarity, making it of interest in synthetic organic chemistry and potential applications in pharmaceuticals or agrochemicals. Its structural features may also impart specific biological activities, warranting further investigation into its potential uses in medicinal chemistry. As with many organic compounds, safety data should be consulted to ensure proper handling and usage.

Formula:C₁₂H₁₆O₄

InChI:InChI=1S/C12H16O4/c1-3-15-10-6-5-9(8-12(13)14)7-11(10)16-4-2/h5-7H,3-4,8H2,1-2H3,(H,13,14)

InChI key:InChIKey=FIKUHWAANCXBGJ-UHFFFAOYSA-N

SMILES:O=C(O)CC1=CC=C(OCC)C(OCC)=C1

Synonyms:
2-(3,4-Diethoxyphenyl)acetic acid
3,4-Diethoxy Phenyl Acetic Acid
3,4-Diethoxybenzeneacetic acid
3,4-Diethyloxy Phenyl acetic acid
Acetic acid, (3,4-diethoxyphenyl)-
Benzeneacetic acid, 3,4-diethoxy-
3,4-Diethoxyphenylacetic acid

Found 4 products.

Product data	Purity	Price range	Estimated delivery
3,4-Diethoxyphenylacetic Acid REF: 3B-D3419CAS: 38464-04-9	>98.0%(GC)(T)	82.00 €	Tue 01 Apr 25
2-(3,4-Diethoxyphenyl)acetic acid REF: IN-DA003IGMCAS: 38464-04-9	%	To inquire	Tue 08 Apr 25
(3,4-Diethoxy-phenyl)-acetic acid REF: 10-F028160CAS: 38464-04-9	95.0%	To inquire	Mon 21 Apr 25
3,4-Diethoxyphenylacetic acid REF: 3D-FD38138CAS: 38464-04-9	Min. 95%	147.00 €~482.00 €	Mon 21 Apr 25