CAS 384819-92-5

2,5-diisothiocyanatobenzenesulfonic acid dihydrate

Description:

2,5-Diisothiocyanatobenzenesulfonic acid dihydrate is a chemical compound characterized by its unique functional groups, specifically the isothiocyanate and sulfonic acid moieties. This compound typically appears as a solid, often in crystalline form, and is soluble in polar solvents due to the presence of the sulfonic acid group. The isothiocyanate groups contribute to its reactivity, making it useful in various chemical synthesis applications, particularly in the field of organic chemistry and bioconjugation. The dihydrate form indicates that it contains two molecules of water, which can influence its stability and solubility. This compound is often utilized in research settings, particularly in the development of dyes, pharmaceuticals, and as a reagent in chemical reactions. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on environmental conditions and the presence of other substances. Safety precautions should be taken when handling this compound, as isothiocyanates can be irritants and may pose health risks.

Formula: C₈H₈N₂O₅S₃

InChI: InChI=1/C8H4N2O3S3.2H2O/c11-16(12,13)8-3-6(9-4-14)1-2-7(8)10-5-15;;/h1-3H,(H,11,12,13);2*1H2

SMILES: c1cc(c(cc1N=C=S)S(=O)(=O)O)N=C=S.O.O

Synonyms:

• Benzenesulfonic acid, 2,5-diisothiocyanato-, hydrate (1:2)

2,5-Diisothiocyanatobenzenesulphonic acid dihydrate

CAS: 384819-92-5

2,5-Diisothiocyanatobenzenesulphonic acid dihydrate

Purity: 95%

Molecular weight: 308.35g/mol

Ref: 54-OR6974