CymitQuimica logo

CAS 38484-94-5

:

2,5-Dichlorobenzenesulfonic acid dihydrate

Description:
2,5-Dichlorobenzenesulfonic acid dihydrate is an organic compound characterized by the presence of two chlorine atoms and a sulfonic acid group attached to a benzene ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the sulfonic acid group, which enhances its hydrophilicity. The dihydrate form indicates that it contains two molecules of water per molecule of the acid, which can influence its physical properties, such as melting point and stability. It is commonly used in various chemical syntheses, particularly in the production of dyes, pharmaceuticals, and other organic compounds. The presence of chlorine substituents can also impart specific reactivity, making it useful in electrophilic substitution reactions. Safety precautions should be observed when handling this compound, as it may be corrosive and can cause irritation to the skin and eyes. Proper storage conditions are essential to maintain its stability and prevent degradation.
Formula:C6H8Cl2O5S
InChI:InChI=1/C6H4Cl2O3S.2H2O/c7-4-1-2-5(8)6(3-4)12(9,10)11;;/h1-3H,(H,9,10,11);2*1H2
InChI key:VPJICTWHRNQYRG-UHFFFAOYSA-N
SMILES:c1cc(c(cc1Cl)S(=O)(=O)O)Cl.O.O
Found 4 products.