CAS 384857-00-5

3-Chloro-4-[(2-chlorophenyl)methoxy]-5-methoxybenzaldehyde

Description:

3-Chloro-4-[(2-chlorophenyl)methoxy]-5-methoxybenzaldehyde is an organic compound characterized by its complex aromatic structure, which includes multiple functional groups. It features a benzaldehyde moiety, indicating the presence of an aldehyde functional group (-CHO), which is typically reactive and can participate in various chemical reactions, such as condensation and oxidation. The compound also contains methoxy groups (-OCH3) that enhance its solubility in organic solvents and may influence its reactivity and biological activity. The presence of chlorine atoms in the structure suggests potential for increased lipophilicity and may affect the compound's pharmacological properties. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can be influenced by the surrounding environment, such as pH and temperature. Additionally, due to its structural features, it may possess interesting biological activities, making it a candidate for further research in medicinal chemistry or related fields. Safety and handling precautions should be observed, as with any chemical substance, particularly those containing halogens.

Formula: C₁₅H₁₂Cl₂O₃

InChI: InChI=1S/C15H12Cl2O3/c1-19-14-7-10(8-18)6-13(17)15(14)20-9-11-4-2-3-5-12(11)16/h2-8H,9H2,1H3

InChI key: InChIKey=RCEISSJAGSJNGG-UHFFFAOYSA-N

SMILES: O(CC1=C(Cl)C=CC=C1)C2=C(OC)C=C(C=O)C=C2Cl

Synonyms:

• 3-Chloro-4-[(2-chlorophenyl)methoxy]-5-methoxybenzaldehyde
• Benzaldehyde, 3-chloro-4-[(2-chlorophenyl)methoxy]-5-methoxy-

3-Chloro-4-[(2-chlorobenzyl)oxy]-5-methoxybenzaldehyde

CAS: 384857-00-5

Versatile small molecule scaffold

Formula: C₁₅H₁₂Cl₂O₃

Purity: Min. 95%

Molecular weight: 311.2 g/mol

Ref: 3D-JQA85700