CAS 384857-33-4

4-Ethoxy-3-iodo-5-methoxybenzaldehyde

Description:

4-Ethoxy-3-iodo-5-methoxybenzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features an ethoxy group (-OEt), an iodo substituent (-I), and a methoxy group (-OCH3) attached to the benzene ring, contributing to its unique chemical properties. The presence of the iodine atom introduces notable reactivity, particularly in nucleophilic substitution reactions, while the methoxy and ethoxy groups can influence the compound's solubility and electronic properties. Typically, compounds like this are used in organic synthesis and may serve as intermediates in the production of pharmaceuticals or agrochemicals. The molecular structure suggests potential applications in medicinal chemistry, particularly due to the presence of the aldehyde functional group, which can participate in various chemical reactions, including condensation and oxidation. Additionally, the compound's physical properties, such as melting point and solubility, would be influenced by the substituents on the benzene ring, making it an interesting subject for further study in synthetic organic chemistry.

Formula: C₁₀H₁₁IO₃

InChI: InChI=1S/C10H11IO3/c1-3-14-10-8(11)4-7(6-12)5-9(10)13-2/h4-6H,3H2,1-2H3

InChI key: InChIKey=UJZLENVBAYKTOQ-UHFFFAOYSA-N

SMILES: O(CC)C1=C(OC)C=C(C=O)C=C1I

Synonyms:

• Benzaldehyde, 4-ethoxy-3-iodo-5-methoxy-
• 4-Ethoxy-3-iodo-5-methoxybenzaldehyde

4-Ethoxy-3-iodo-5-methoxybenzaldehyde

CAS: 384857-33-4

Versatile small molecule scaffold

Formula: C₁₀H₁₁IO₃

Purity: Min. 95%

Molecular weight: 306.1 g/mol

Ref: 3D-JQA85733