CAS 384859-48-7

4-[5-(4-fluorophenyl)-2H-tetrazol-2-yl]butanoic acid

Description:

4-[5-(4-Fluorophenyl)-2H-tetrazol-2-yl]butanoic acid is a chemical compound characterized by its unique structure, which includes a butanoic acid moiety and a tetrazole ring substituted with a fluorophenyl group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the carboxylic acid functional group. The fluorine atom in the phenyl ring can influence the compound's electronic properties, potentially enhancing its biological activity or reactivity. The tetrazole ring contributes to the compound's stability and may also play a role in its pharmacological properties. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential interactions with biological targets. Its specific characteristics, such as melting point, boiling point, and spectral data, would be determined through experimental methods and may vary based on purity and environmental conditions.

Formula: C₁₁H₁₁FN₄O₂

InChI: InChI=1/C11H11FN4O2/c12-9-5-3-8(4-6-9)11-13-15-16(14-11)7-1-2-10(17)18/h3-6H,1-2,7H2,(H,17,18)

SMILES: C(CC(=O)O)Cn1nc(c2ccc(cc2)F)nn1

4-[5-(4-fluorophenyl)-2H-tetrazol-2-yl]butanoic acid

CAS: 384859-48-7

Formula: C₁₁H₁₁FN₄O₂

Purity: 95.0%

Molecular weight: 250.233

Ref: 10-F315016