CAS 384860-18-8

2-methyl-5-(1H-tetrazol-1-yl)aniline

Description:

2-Methyl-5-(1H-tetrazol-1-yl)aniline is an organic compound characterized by its aromatic amine structure, which features a methyl group and a tetrazole ring. The presence of the tetrazole moiety contributes to its potential as a bioactive compound, often enhancing solubility and reactivity. This compound typically exhibits moderate to high polarity due to the functional groups present, influencing its solubility in various solvents. It may also display interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The aniline part of the molecule can participate in various chemical reactions, such as electrophilic substitutions, while the tetrazole ring can engage in coordination with metal ions or serve as a bioisostere for carboxylic acids. Overall, 2-methyl-5-(1H-tetrazol-1-yl)aniline is notable for its structural complexity and potential applications in drug development and materials science.

Formula: C₈H₉N₅

InChI: InChI=1/C8H9N5/c1-6-2-3-7(4-8(6)9)13-5-10-11-12-13/h2-5H,9H2,1H3

SMILES: Cc1ccc(cc1N)n1cnnn1

Synonyms:

• 2-Methyl-5-tetrazol-1-yl-phenylamine
• benzenamine, 2-methyl-5-(1H-tetrazol-1-yl)-

2-Methyl-5-(1H-tetrazol-1-yl)aniline

CAS: 384860-18-8

2-Methyl-5-(1H-tetrazol-1-yl)aniline is a chemical compound with the formula C6H3N3. It is a white solid that is soluble in water and ethanol. 2-Methyl-5-(1H-tetrazol-1-yl)aniline has been used as a reagent for the determination of the rate of spontaneous reactions, such as condensation reactions, by measuring the rate constant for these reactions. The values of its constants are found in Table 1.

Formula: C₈H₉N₅

Purity: Min. 95%

Molecular weight: 175.19 g/mol

Ref: 3D-JQA86018