CAS 38487-85-3

2-Amino-4-methoxybenzonitrile

Description:

2-Amino-4-methoxybenzonitrile, with the CAS number 38487-85-3, is an organic compound characterized by the presence of an amino group (-NH2), a methoxy group (-OCH3), and a nitrile group (-CN) attached to a benzene ring. This compound typically appears as a solid at room temperature and is soluble in polar organic solvents due to its functional groups. The amino group can participate in hydrogen bonding, enhancing its solubility in water compared to non-polar compounds. The methoxy group contributes to the compound's electron-donating properties, which can influence its reactivity and interaction with other chemical species. Additionally, the nitrile group is known for its ability to stabilize negative charges, making the compound potentially useful in various chemical reactions, including nucleophilic substitutions. 2-Amino-4-methoxybenzonitrile may find applications in pharmaceuticals, agrochemicals, and as an intermediate in organic synthesis, owing to its diverse functional groups that allow for further chemical modifications.

Formula: C₈H₈N₂O

InChI: InChI=1/C8H8N2O/c1-11-7-3-2-6(5-9)8(10)4-7/h2-4H,10H2,1H3

SMILES: COc1ccc(C#N)c(c1)N

Synonyms:

• Benzonitrile, 2-Amino-4-Methoxy-

2-Amino-4-methoxybenzonitrile

CAS: 38487-85-3

Formula: C₈H₈N₂O

Purity: 96%

Color and Shape: Solid

Molecular weight: 148.1619

Ref: IN-DA00CIRA

2-Amino-4-methoxybenzonitrile

CAS: 38487-85-3

2-Amino-4-methoxybenzonitrile

Purity: 97%

Molecular weight: 148.16g/mol

Ref: 54-OR906314

2-Amino-4-methoxybenzonitrile

CAS: 38487-85-3

Formula: C₈H₈N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 148.165

Ref: 10-F079678