CAS 38487-86-4
:2-Amino-4-chlorobenzonitrile
Description:
2-Amino-4-chlorobenzonitrile, with the CAS number 38487-86-4, is an organic compound characterized by the presence of an amino group (-NH2) and a cyano group (-C≡N) attached to a benzene ring that also contains a chlorine atom. This compound typically appears as a solid and is known for its aromatic properties due to the benzene structure. The amino group contributes to its basicity, while the cyano group imparts significant polarity, making it a useful intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. The chlorine atom enhances the compound's reactivity, allowing for various substitution reactions. Additionally, 2-amino-4-chlorobenzonitrile may exhibit moderate solubility in polar solvents, and its physical and chemical properties can be influenced by the presence of the functional groups. Safety data should be consulted, as it may pose health risks if handled improperly, emphasizing the importance of using appropriate safety measures in laboratory settings.
Formula:C7H5ClN2
InChI:InChI=1S/C7H5ClN2/c8-6-2-1-5(4-9)7(10)3-6/h1-3H,10H2
InChI key:InChIKey=UZHALXIAWJOLLR-UHFFFAOYSA-N
SMILES:C(#N)C1=C(N)C=C(Cl)C=C1
Synonyms:- 4-Chloro-2-aminobenzonitrile
- 4-Chloroanthranilonitrile
- 5-Chloro-2-Cyanoaniline
- Anthranilonitrile, 4-chloro-
- Benzonitrile, 2-amino-4-chloro-
- 2-Amino-4-chlorobenzonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Amino-4-chlorobenzonitrile
CAS:Formula:C7H5ClN2Purity:>98.0%(GC)Color and Shape:Light orange to Yellow to Green powder to crystalMolecular weight:152.58Benzonitrile, 2-amino-4-chloro-
CAS:Formula:C7H5ClN2Purity:98%Color and Shape:SolidMolecular weight:152.58102-Amino-4-chlorobenzonitrile
CAS:2-Amino-4-chlorobenzonitrileFormula:C7H5ClN2Purity:≥95%Color and Shape: bright. pale lemon crystalline powderMolecular weight:152.58g/mol2-Amino-4-chlorobenzonitrile
CAS:2-Amino-4-chlorobenzonitrile is a synthetic molecule that can be synthesized in a metal chelator. It has potent inhibitory activities against amines, choline, and other molecules. 2-Amino-4-chlorobenzonitrile also has fluorescence properties. The reaction mechanism of 2-Amino-4-chlorobenzonitrile is not well understood, but it is believed to inhibit the synthesis of proteins by binding to their functional groups. This chemical can also enhance the rate of reactions by removing a hydrogen ion from the reactant.Formula:C7H5ClN2Purity:Min. 95%Color and Shape:PowderMolecular weight:152.58 g/mol2-Amino-4-chlorobenzonitrile
CAS:Formula:C7H5ClN2Purity:98%Color and Shape:SolidMolecular weight:152.58




