CAS 3849-01-2
:1,3,5-tris(chloromethyl)-2,4,6-trimethylbenzene
Description:
1,3,5-Tris(chloromethyl)-2,4,6-trimethylbenzene, with the CAS number 3849-01-2, is an organic compound characterized by its complex structure featuring a benzene ring substituted with three chloromethyl groups and three methyl groups. This compound is typically a colorless to pale yellow solid at room temperature and is known for its reactivity due to the presence of chloromethyl groups, which can undergo nucleophilic substitution reactions. The presence of multiple methyl groups contributes to its hydrophobic nature and can influence its solubility in organic solvents. It is often used in organic synthesis and as an intermediate in the production of various chemical products. Safety precautions are necessary when handling this compound, as chlorinated compounds can be hazardous, and appropriate measures should be taken to avoid exposure. Additionally, its environmental impact and potential toxicity should be considered in any application or disposal scenario.
Formula:C12H15Cl3
InChI:InChI=1/C12H15Cl3/c1-7-10(4-13)8(2)12(6-15)9(3)11(7)5-14/h4-6H2,1-3H3
Synonyms:- 1,3,5-Tris-chloromethyl-2,4,6-trimethyl-benzene
- Benzene, 1,3,5-tris(chloromethyl)-2,4,6-trimethyl-
- 1,3,5-Tris(chloromethyl)-2,4,6-trimethylbenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,3,5-Tris(chloromethyl)-2,4,6-trimethylbenzene, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C12H15Cl3Purity:97%Molecular weight:265.601,3,5-Trimethyl-2,4,6-tris(chloromethyl)benzene
CAS:Formula:C12H15Cl3Purity:97%Color and Shape:SolidMolecular weight:265.60651,3,5-Tris(chloromethyl)-2,4,6-trimethylbenzene
CAS:1,3,5-Tris(chloromethyl)-2,4,6-trimethylbenzenePurity:97%Molecular weight:265.61g/mol1,3,5-Tris(chloromethyl)-2,4,6-trimethylbenzene
CAS:Formula:C12H15Cl3Purity:95.0%Molecular weight:265.6



