CymitQuimica logo

CAS 38492-81-8

:

1,3-Dichloro-6-(trifluoromethyl)-9-phenanthrenemethanol

Description:
1,3-Dichloro-6-(trifluoromethyl)-9-phenanthrenemethanol is a chemical compound characterized by its complex structure, which includes a phenanthrene backbone substituted with dichloro and trifluoromethyl groups. This compound typically exhibits properties associated with halogenated organic compounds, such as increased stability and potential lipophilicity due to the presence of multiple halogen atoms. The trifluoromethyl group is known for imparting unique electronic properties, which can enhance the compound's reactivity and interaction with biological systems. Additionally, the presence of the hydroxyl (-OH) group suggests potential for hydrogen bonding, influencing solubility and reactivity. This compound may be of interest in various fields, including materials science and medicinal chemistry, due to its potential applications in drug development or as a precursor in synthetic pathways. However, specific safety and handling guidelines should be followed, as halogenated compounds can pose environmental and health risks.
Formula:C16H9Cl2F3O
InChI:InChI=1S/C16H9Cl2F3O/c17-10-5-13-12-4-9(16(19,20)21)1-2-11(12)8(7-22)3-14(13)15(18)6-10/h1-6,22H,7H2
InChI key:InChIKey=ANDPCRISJIJFCB-UHFFFAOYSA-N
SMILES:C(O)C1=C2C(=C3C(=C1)C(Cl)=CC(Cl)=C3)C=C(C(F)(F)F)C=C2
Synonyms:
  • 1,3-Dichloro-6-(trifluoromethyl)-9-phenanthrenemethanol
  • 9-Phenanthrenemethanol, 1,3-dichloro-6-(trifluoromethyl)-
  • [1,3-Dichloro-6-(Trifluoromethyl)Phenanthren-9-Yl]Methanol
  • 1,3-Dichloro-6-(trifluoromethyl)phenanthren-9-methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.