CAS 38493-59-3
:(3-bromo-4-methoxyphenyl)methanol
Description:
(3-Bromo-4-methoxyphenyl)methanol is an organic compound characterized by its phenolic structure, which includes a bromine atom and a methoxy group attached to a benzene ring. The presence of the bromine atom at the meta position and the methoxy group at the para position relative to the hydroxymethyl group contributes to its unique reactivity and physical properties. This compound is typically a white to off-white solid at room temperature and is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water due to its hydrophobic aromatic structure. It can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it useful in synthetic organic chemistry. Additionally, the presence of the hydroxymethyl group allows for potential hydrogen bonding interactions, which can influence its boiling and melting points. As with many brominated compounds, it may exhibit biological activity, warranting further investigation in pharmacological contexts. Safety precautions should be taken when handling this compound, as it may pose health risks.
Formula:C8H9BrO2
InChI:InChI=1/C8H9BrO2/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4,10H,5H2,1H3
SMILES:COc1ccc(cc1Br)CO
Synonyms:- 3-Bromo-4-methoxybenzenemethanol
- 3-Bromo-4-methoxybenzyl alcohol
- Benzenemethanol, 3-bromo-4-methoxy-
- Q1R Ce Do1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-BROMO-4-METHOXYBENZYL ALCOHOL
CAS:Formula:C8H9BrO2Purity:97%Color and Shape:SolidMolecular weight:217.05993-Bromo-4-methoxybenzyl alcohol
CAS:3-Bromo-4-methoxybenzyl alcoholPurity:97%Molecular weight:217.06g/mol3-Bromo-4-methoxybenzyl alcohol
CAS:3-Bromo-4-methoxybenzyl alcohol is a natural product that belongs to the group of alcohols. It is an intermediate in the synthesis of combretastatin A-4 and combretastatin. 3-Bromo-4-methoxybenzyl alcohol has been shown to have a molecular modeling pharmacophore that includes a triazole and chloride. The chloroiodomethane used in its synthesis can be brominated, which results in two possible products, 3-bromo-4-methoxybenzyl bromide or 3-bromo-4,5'-dimethoxybenzyl bromide. The hydroxyl group on the 3'-position of the benzene ring can also be replaced with a methoxy group.Formula:C8H9BrO2Purity:Min. 95%Molecular weight:217.06 g/mol3-Bromo-4-methoxybenzyl alcohol
CAS:Formula:C8H9BrO2Purity:97%Color and Shape:SolidMolecular weight:217.062



