
CAS 3850-43-9
:N-[3-(4-Hydroxyphenyl)-1-oxopropyl]glycine
Description:
N-[3-(4-Hydroxyphenyl)-1-oxopropyl]glycine, also known by its CAS number 3850-43-9, is an organic compound characterized by its structure, which includes a glycine moiety linked to a propanoyl group substituted with a 4-hydroxyphenyl group. This compound exhibits properties typical of amino acids, including the ability to participate in hydrogen bonding due to the presence of both an amine and a carboxylic acid functional group. The hydroxyl group on the phenyl ring contributes to its potential for forming additional hydrogen bonds, enhancing its solubility in polar solvents. The presence of the ketone functional group (1-oxopropyl) suggests that it may engage in various chemical reactions, such as nucleophilic attacks or condensation reactions. This compound may also exhibit biological activity, potentially acting as a precursor or intermediate in the synthesis of pharmaceuticals or other bioactive molecules. Its specific applications and reactivity would depend on the context of its use in research or industry.
Formula:C11H13NO4
InChI:InChI=1S/C11H13NO4/c13-9-4-1-8(2-5-9)3-6-10(14)12-7-11(15)16/h1-2,4-5,13H,3,6-7H2,(H,12,14)(H,15,16)
InChI key:InChIKey=KPKFTTASECYTCL-UHFFFAOYSA-N
SMILES:C(CC(NCC(O)=O)=O)C1=CC=C(O)C=C1
Synonyms:- N-[3-(4-Hydroxyphenyl)-1-oxopropyl]glycine
- 2-[3-(4-Hydroxyphenyl)propanamido]acetic acid
- Glycine, N-(p-hydroxyhydrocinnamoyl)-
- Glycine, N-[3-(4-hydroxyphenyl)-1-oxopropyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Hydroxyphenylpropionylglycine
CAS:<p>4-Hydroxyphenylpropionylglycine, a metabolite derived from the conditionally essential amino acid tyrosine, is synthesized through a process involving aromatic</p>Formula:C11H13NO4Color and Shape:SolidMolecular weight:223.23
