CAS 385399-11-1

S-{3-[(2,5-dioxopyrrolidin-1-yl)oxy]-3-oxopropyl} methanesulfonothioate

Description:

S-{3-[(2,5-dioxopyrrolidin-1-yl)oxy]-3-oxopropyl} methanesulfonothioate, identified by its CAS number 385399-11-1, is a synthetic organic compound characterized by its complex structure, which includes a methanesulfonothioate group and a pyrrolidine derivative. This compound features a sulfonothioate moiety, which is known for its potential reactivity and ability to participate in various chemical reactions, including nucleophilic substitutions. The presence of the pyrrolidine ring suggests that it may exhibit specific biological activities, possibly related to its interaction with biological macromolecules. The compound's solubility and stability can vary depending on the solvent and environmental conditions, making it important for applications in medicinal chemistry and drug development. Additionally, its unique functional groups may confer specific properties, such as the ability to form hydrogen bonds or engage in electrostatic interactions, which can influence its behavior in biological systems. Overall, this compound represents a class of molecules that may have significant implications in pharmaceutical research and development.

Formula: C₈H₁₁NO₆S₂

InChI: InChI=1/C8H11NO6S2/c1-17(13,14)16-5-4-8(12)15-9-6(10)2-3-7(9)11/h2-5H2,1H3

SMILES: CS(=O)(=O)SCCC(=O)ON1C(=O)CCC1=O

Synonyms:

• 3-[(Methylsulfonyl)thio]-

N-Succinimidyloxycarbonylethyl Methanethiosulfonate

Controlled Product

CAS: 385399-11-1

Stability Moisture Sensitive: Desiccate
Applications A heterobifunctional sulfhydryl cross-linking reagent.

Formula: C₈H₁₁NO₆S₂

Color and Shape: Neat

Molecular weight: 281.31

Ref: TR-S691250