CAS 3855-78-5

1-(3,4-dihydroquinolin-1(2H)-yl)-2-({4-ethyl-5-[(3-methoxyphenoxy)methyl]-4H-1,2,4-triazol-3-yl}sulfanyl)ethanone

Description:

1-(3,4-dihydroquinolin-1(2H)-yl)-2-({4-ethyl-5-[(3-methoxyphenoxy)methyl]-4H-1,2,4-triazol-3-yl}sulfanyl)ethanone, with CAS number 3855-78-5, is a synthetic organic compound characterized by its complex molecular structure, which includes a quinoline moiety and a triazole ring. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of functional groups, such as the triazole and sulfanyl groups, suggests possible interactions with biological targets, which may contribute to its pharmacological properties. Its molecular structure indicates potential for diverse applications, particularly in the development of pharmaceuticals or agrochemicals. The compound's stability, reactivity, and specific interactions would depend on the surrounding conditions, including pH and solvent environment. Overall, this compound represents a class of heterocyclic compounds that are often explored for their therapeutic potential.

Formula: C₂₃H₂₆N₄O₃S

InChI: InChI=1/C23H26N4O3S/c1-3-26-21(15-30-19-11-6-10-18(14-19)29-2)24-25-23(26)31-16-22(28)27-13-7-9-17-8-4-5-12-20(17)27/h4-6,8,10-12,14H,3,7,9,13,15-16H2,1-2H3

SMILES: CCn1c(COc2cccc(c2)OC)nnc1SCC(=O)N1CCCc2ccccc12

2,3,4-Trimethyl-1H-pyrrole

CAS: 3855-78-5

Formula: C₇H₁₁N

Purity: 95%

Color and Shape: Solid

Molecular weight: 109.1689

Ref: IN-DA00C09L

2,3,4-Trimethyl-1H-pyrrole

CAS: 3855-78-5

2,3,4-Trimethyl-1H-pyrrole

Purity: 95%

Molecular weight: 109.17g/mol

Ref: 54-OR1045870

2,3,4-Trimethyl-1h-pyrrole

CAS: 3855-78-5

Purity: 95%

Molecular weight: 109.1719971

Ref: 10-F640953