CAS 38557-76-5

N-hydroxy-4-methyl-N-phenylbenzenesulfonamide

Description:

N-hydroxy-4-methyl-N-phenylbenzenesulfonamide, with the CAS number 38557-76-5, is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a hydroxylamine group (N-hydroxy) attached to a sulfonamide structure, which contributes to its potential biological activity. The presence of a methyl group and a phenyl group in its structure enhances its lipophilicity, potentially influencing its solubility and reactivity. N-hydroxy-4-methyl-N-phenylbenzenesulfonamide may exhibit properties such as being a weak acid, and it can participate in various chemical reactions, including nucleophilic substitutions and redox reactions. Its applications may extend to pharmaceuticals, particularly in the development of drugs targeting bacterial infections or other therapeutic areas. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₁₃H₁₃NO₃S

InChI: InChI=1/C13H13NO3S/c1-11-7-9-13(10-8-11)18(16,17)14(15)12-5-3-2-4-6-12/h2-10,15H,1H3

SMILES: Cc1ccc(cc1)S(=O)(=O)N(c1ccccc1)O

N-Hydroxy-4-methyl-N-phenylbenzene-1-sulfonamide

CAS: 38557-76-5

Versatile small molecule scaffold

Formula: C₁₃H₁₃NO₃S

Purity: Min. 95%

Molecular weight: 263.31 g/mol

Ref: 3D-NBA55776