CAS 385769-84-6: Aminotadalafil
Description:Aminotadalafil, with the CAS number 385769-84-6, is a chemical compound that belongs to the class of phosphodiesterase type 5 (PDE5) inhibitors. It is structurally related to tadalafil, a well-known medication used primarily for the treatment of erectile dysfunction and pulmonary arterial hypertension. Aminotadalafil features an amino group that enhances its pharmacological properties. The compound exhibits a mechanism of action that involves the inhibition of PDE5, leading to increased levels of cyclic guanosine monophosphate (cGMP) in the smooth muscle cells of blood vessels, resulting in vasodilation and improved blood flow. This compound is characterized by its relatively high potency and selectivity for PDE5 compared to other phosphodiesterases. Additionally, aminotadalafil may have a favorable pharmacokinetic profile, contributing to its therapeutic efficacy. As with other PDE5 inhibitors, potential side effects may include headaches, flushing, and gastrointestinal disturbances. Research into aminotadalafil continues, focusing on its efficacy, safety, and potential applications in various medical conditions.
Formula:C21H18N4O4
InChI:InChI=1S/C21H18N4O4/c22-24-9-18(26)25-15(21(24)27)8-13-12-3-1-2-4-14(12)23-19(13)20(25)11-5-6-16-17(7-11)29-10-28-16/h1-7,15,20,23H,8-10,22H2/t15-,20-/m1/s1
InChI key:InChIKey=VUKJGAVIWMPOOJ-FOIQADDNSA-N
SMILES:O=C1N2C(C3=CC=C4OCOC4=C3)C=5NC=6C=CC=CC6C5CC2C(=O)N(N)C1
- Synonyms:
- (6R,12aR)-2-Amino-6-(1,3-benzodioxol-5-yl)-2,3,6,7,12,12a-hexahydropyrazino[1′,2′:1,6]pyrido[3,4-b]indole-1,4-dione
- Amino Tadalafil
- Aminotadalafil
- Pyrazino[1′,2′:1,6]pyrido[3,4-b]indole-1,4-dione, 2-amino-6-(1,3-benzodioxol-5-yl)-2,3,6,7,12,12a-hexahydro-, (6R,12aR)-
- ATF
