CAS 38582-18-2
:Cyclohexanebutanoic acid, zinc salt (2:1)
Description:
Cyclohexanebutanoic acid, zinc salt (2:1), with the CAS number 38582-18-2, is a coordination compound formed from cyclohexanebutanoic acid and zinc ions. This compound typically exhibits characteristics associated with both organic acids and metal salts. It is likely to be a white to off-white solid, soluble in polar solvents, and may have limited solubility in non-polar solvents. The presence of zinc suggests potential applications in various fields, including agriculture as a micronutrient or in pharmaceuticals due to its biocompatibility. The 2:1 stoichiometry indicates that two molecules of the acid coordinate with one zinc ion, which may influence its stability and reactivity. The compound may also exhibit unique properties such as enhanced thermal stability or altered solubility compared to its parent acid. Additionally, it may possess specific biological activities, making it of interest in research related to nutrition or medicinal chemistry. As with any chemical substance, safety data sheets should be consulted for handling and toxicity information.
Formula:C10H18O2Zn
InChI:InChI=1S/C10H18O2.Zn/c11-10(12)8-4-7-9-5-2-1-3-6-9;/h9H,1-8H2,(H,11,12);
InChI key:InChIKey=NTBVHGFYGRTHQM-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)C1CCCCC1.[Zn]
Synonyms:- Cyclohexanebutanoic acid, zinc salt
- Cyclohexanebutanoic acid, zinc salt (2:1)
- Zinc 4-cyclohexylbutyrate
- Zinc Bis(4-Cyclohexylbutanoate)
- Zinc Bis(4-Cyclohexylbutanoate) Dihydrate
- Zinc(II) cyclohexanebutyrate
- Zinc cyclohexylbutyrate
- Zinc cyclohexylbutyrate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Zinc cyclohexanebutyrate, AAS
CAS:Formula:Zn(O2C10H17)2·2H2OColor and Shape:White crystalline powderMolecular weight:403.86Zinc cyclohexanebutyrate dihydrate (AAS)
CAS:Zinc cyclohexanebutyrate dihydrate (AAS)
Formula:ZnOOC(CH2)3C6H11·2H2OColor and Shape:white pwdr.Molecular weight:403.87 (439.90)


