CAS 3859-35-6
:1-ethenylcyclopentanol
Description:
1-Ethenylcyclopentanol, with the CAS number 3859-35-6, is an organic compound characterized by its cyclopentane ring structure with a vinyl group (ethenyl) and a hydroxyl group (alcohol) attached. This compound typically exhibits a colorless to pale yellow liquid form and has a distinctive odor. It is soluble in organic solvents and has limited solubility in water due to the hydrophobic nature of the cyclopentane ring. The presence of the hydroxyl group imparts some polar characteristics, allowing for hydrogen bonding, which can influence its reactivity and interactions with other substances. 1-Ethenylcyclopentanol can participate in various chemical reactions, including polymerization and oxidation, making it of interest in synthetic organic chemistry. Its unique structure may also confer specific properties that could be useful in applications such as fragrance, flavoring, or as an intermediate in the synthesis of more complex molecules. However, safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C7H12O
InChI:InChI=1/C7H12O/c1-2-7(8)5-3-4-6-7/h2,8H,1,3-6H2
SMILES:C=CC1(CCCC1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Vinylcyclopentanol (contains ~1% Hydroquinone as stabilizer)
CAS:Controlled ProductFormula:C7H12OColor and Shape:NeatMolecular weight:112.17
