CAS 38595-89-0

(3-Acryloxypropyl)trichlorosilane

Description:

(3-Acryloxypropyl)trichlorosilane, with the CAS number 38595-89-0, is an organosilicon compound characterized by the presence of both acryloxy and trichlorosilane functional groups. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity due to the presence of the trichlorosilane moiety, which can readily hydrolyze in the presence of moisture, forming silanol groups. The acryloxy group allows for potential polymerization and cross-linking reactions, making it useful in various applications, including surface modification, adhesion promotion, and as a coupling agent in the synthesis of hybrid organic-inorganic materials. Its ability to bond with both organic and inorganic substrates enhances the durability and performance of coatings, adhesives, and composites. Safety considerations include handling it in a well-ventilated area and using appropriate personal protective equipment, as it can be corrosive and irritating to the skin and eyes. Overall, (3-Acryloxypropyl)trichlorosilane is valued in materials science and chemical manufacturing for its versatility and functional properties.

Formula: C₆H₉Cl₃O₂Si

InChI: InChI=1/C6H9Cl3O2Si/c1-2-6(10)11-4-3-5-12(7,8)9/h2H,1,3-5H2

SMILES: C=CC(=O)OCCC[Si](Cl)(Cl)Cl

Synonyms:

• 3-(Trichlorosilyl)Propyl Prop-2-Enoate

[3-(Acryloxy)propyl]trichlorosilane

CAS: 38595-89-0

Formula: C₆H₉Cl₃O₂Si

Purity: 95%

Color and Shape: Liquid

Molecular weight: 247.5790

Ref: IN-DA00C7PH

3-Acryloxypropyltrichlorosilane

CAS: 38595-89-0

3-Acryloxypropyltrichlorosilane

Purity: 95%

Molecular weight: 247.58g/mol

Ref: 54-OR1024932