CAS 38598-34-4

Bis(cyclohexanebutanoato-κO)hydroxyaluminum

Description:

Bis(cyclohexanebutanoato-κO)hydroxyaluminum, with the CAS number 38598-34-4, is a coordination compound that features aluminum as its central metal atom, coordinated by two cyclohexanebutanoate ligands and a hydroxy group. This compound typically exhibits characteristics associated with aluminum complexes, such as potential solubility in organic solvents and the ability to form stable complexes with various ligands. The presence of the cyclohexanebutanoate groups suggests that it may have applications in organic synthesis or as a catalyst, given the steric and electronic properties imparted by the bulky cyclohexane rings. Additionally, the hydroxy group can participate in hydrogen bonding, influencing the compound's reactivity and interactions with other molecules. The overall structure may contribute to its stability and functionality in various chemical environments. As with many aluminum-based compounds, it is important to handle this substance with care, considering potential reactivity and safety protocols.

Formula: C₂₀H₃₅AlO₅

InChI: InChI=1S/2C10H18O2.Al.H2O/c2*11-10(12)8-4-7-9-5-2-1-3-6-9;;/h2*9H,1-8H2,(H,11,12);;1H2/q;;+3;/p-3

InChI key: InChIKey=JUGYFOMQOWSWDP-UHFFFAOYSA-K

SMILES: C(CCC(O[Al](OC(CCCC1CCCCC1)=O)O)=O)C2CCCCC2

Synonyms:

• Aluminum, bis(cyclohexanebutanoato-κO)hydroxy-
• Cyclohexanebutanoic acid, aluminum complex
• Aluminum, bis(cyclohexanebutanoato-O)hydroxy-
• Bis(4-cyclohexylbutyrato)hydroxyaluminum
• Bis(cyclohexanebutanoato-κO)hydroxyaluminum

Aluminium cyclohexanebutyrate

CAS: 38598-34-4

Formula: C₂₀H₃₅AlO₅

Molecular weight: 382.4704

Ref: IN-DA0034GB