
CAS 38602-53-8
:Calliterpenone
Description:
Calliterpenone is a naturally occurring sesquiterpene ketone, primarily derived from certain plant sources, particularly those in the genus Callitris. It is characterized by its complex molecular structure, which includes multiple rings and functional groups typical of terpenes. Calliterpenone exhibits a distinctive aroma, often described as woody or earthy, making it of interest in the fragrance and flavor industries. Its chemical properties include moderate volatility and solubility in organic solvents, which facilitate its extraction and application in various formulations. Additionally, Calliterpenone has been studied for its potential biological activities, including antimicrobial and anti-inflammatory properties, although further research is necessary to fully understand its pharmacological effects. The compound's CAS number, 38602-53-8, allows for precise identification and reference in scientific literature and regulatory contexts. Overall, Calliterpenone represents a fascinating example of the diverse chemistry found in natural products, with potential applications in both industry and medicine.
Formula:C20H32O3
InChI:InChI=1S/C20H32O3/c1-17(2)14-6-9-19-10-13(20(23,11-19)12-21)4-5-15(19)18(14,3)8-7-16(17)22/h13-15,21,23H,4-12H2,1-3H3/t13-,14+,15-,18+,19+,20+/m1/s1
InChI key:InChIKey=MPDUJZZNNBJFAB-NBUFYSGYSA-N
SMILES:C[C@@]12[C@@]3([C@]4(C[C@]([C@](CO)(O)C4)(CC3)[H])CC[C@]1(C(C)(C)C(=O)CC2)[H])[H]
Synonyms:- Kauran-3-one, 16,17-dihydroxy-, (5α,9α,10β)-
- Hoffmanniaketone
- (5α,9α,10β)-16,17-Dihydroxykauran-3-one
- Calliterpenone
- 1H-2,10a-Ethanophenanthrene, kauran-3-one deriv.
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Calliterpenone
CAS:<p>Calliterpenone is a useful organic compound for research related to life sciences. The catalog number is T124920 and the CAS number is 38602-53-8.</p>Formula:C20H32O3Color and Shape:SolidMolecular weight:320.473
