CAS 38603-72-4
:Ethanamine, 2-[[(4-methyl-1H-imidazol-5-yl)methyl]thio]-, hydrochloride (1:2)
Description:
Ethanamine, 2-[[(4-methyl-1H-imidazol-5-yl)methyl]thio]-, hydrochloride (1:2) is a chemical compound characterized by its amine functional group and the presence of an imidazole ring, which contributes to its biological activity. The compound features a thioether linkage, indicating the presence of a sulfur atom bonded to a carbon chain, enhancing its reactivity and potential interactions with biological systems. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in various applications, including pharmaceuticals and biochemistry. The imidazole moiety is known for its role in biological systems, particularly in enzyme active sites and as a building block for various biomolecules. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Its properties, such as solubility, stability, and reactivity, are influenced by the presence of both the amine and imidazole functionalities, making it a compound of interest in research and development.
Formula:C7H13N3S·2ClH
InChI:InChI=1S/C7H13N3S.2ClH/c1-6-7(10-5-9-6)4-11-3-2-8;;/h5H,2-4,8H2,1H3,(H,9,10);2*1H
InChI key:InChIKey=VFWUYASTZCOUKN-UHFFFAOYSA-N
SMILES:C(SCCN)C1=C(C)N=CN1.Cl
Synonyms:- 2-{[(5-methyl-1H-imidazol-4-yl)methyl]sulfanyl}ethanamine dihydrochloride
- 4-Methyl-5-[(2-aminoethyl)thiomethyl]imidazole dihydrochloride
- 4-[(2-Aminoethyl)thiomethyl]-5-methylimidazole dihydrochloride
- 5-[[(2-Aminoethyl)thio]methyl]-4-methylimidazole dihydrochloride
- Ethanamine, 2-[[(4-methyl-1H-imidazol-5-yl)methyl]thio]-, hydrochloride (1:2)
- Ethanamine, 2-[[(5-methyl-1H-imidazol-4-yl)methyl]thio]-, dihydrochloride
- 2-(((5-Methyl-1H-imidazol-4-yl)methyl)thio)ethylamine dihydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-[[(5-methyl-1H-imidazol-4-yl)methyl]thio]ethylamine dihydrochloride
CAS:Formula:C7H15Cl2N3SPurity:97%Color and Shape:SolidMolecular weight:244.1851Cimetidine EP Impurity J DiHCl
CAS:Formula:C7H13N3S·2HClColor and Shape:White To Off-White SolidMolecular weight:171.26 2*36.462-(((4-Methyl-1H-imidazol-5-yl)methyl)thio)ethanamine dihydrochloride
CAS:2-(((4-Methyl-1H-imidazol-5-yl)methyl)thio)ethanamine dihydrochloridePurity:97%4-Methyl-5-[(2-aminoethyl)thiomethyl]imidazole Dihydrochloride
CAS:Controlled ProductFormula:C7H13N3S·2ClHColor and Shape:NeatMolecular weight:244.19(2-{[(4-methyl-1H-imidazol-5-yl)methyl]thio}ethyl)amine dihydrochloride
CAS:Formula:C7H15Cl2N3SPurity:97%Molecular weight:244.184-Methyl-5-[(2-aminoethyl)thiomethyl]imidazole dihydrochloride
CAS:<p>4-Methyl-5-[(2-aminoethyl)thiomethyl]imidazole dihydrochloride is a synthetic drug product that has been purified to high purity. This compound is used as an analytical standard and impurity in the development of drugs. 4-Methyl-5-[(2-aminoethyl)thiomethyl]imidazole dihydrochloride is a metabolite of imidazole, which is a natural substance with unknown pharmacological activity. It has been found to be an impurity in the synthesis of various pharmaceuticals, including metronidazole and ampicillin. This product has not yet been evaluated for safety or efficacy in humans.</p>Formula:C7H13N3S·2HClPurity:Min. 95%Molecular weight:244.19 g/mol







