CymitQuimica logo

CAS 38608-07-0

:

1,3-benzodioxole-5,6-diamine

Description:
1,3-Benzodioxole-5,6-diamine, identified by its CAS number 38608-07-0, is an organic compound characterized by its unique bicyclic structure that incorporates a benzodioxole moiety with two amino groups at the 5 and 6 positions. This compound typically exhibits properties associated with aromatic amines, such as potential solubility in polar solvents and moderate stability under standard conditions. The presence of the dioxole ring contributes to its reactivity, particularly in electrophilic substitution reactions. Additionally, the amino groups can participate in hydrogen bonding and may influence the compound's biological activity, making it of interest in medicinal chemistry. Its structural features suggest potential applications in the synthesis of dyes, pharmaceuticals, or as intermediates in organic synthesis. However, safety considerations are paramount, as many aromatic amines can be toxic or carcinogenic. Therefore, handling this compound requires appropriate safety measures to mitigate exposure risks.
Formula:C7H8N2O2
InChI:InChI=1/C7H8N2O2/c8-4-1-6-7(2-5(4)9)11-3-10-6/h1-2H,3,8-9H2
SMILES:c1c(c(cc2c1OCO2)N)N
Synonyms:
  • 1,2-Diamino-4,5-methylenedioxy-benzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.