CAS 38609-97-1
:N-(Carboxymethyl)acridone
Description:
N-(Carboxymethyl)acridone is an organic compound characterized by its acridone backbone, which is a fused ring structure containing both a benzene and a pyridine-like moiety. The presence of a carboxymethyl group (-CH2COOH) enhances its solubility in polar solvents and introduces acidic properties, allowing it to participate in various chemical reactions. This compound typically exhibits fluorescence, making it useful in applications such as dyes and fluorescent probes. Its molecular structure contributes to its potential biological activity, including antimicrobial and anticancer properties, which have been explored in various studies. Additionally, N-(Carboxymethyl)acridone can form salts and complexes with metal ions, further expanding its utility in coordination chemistry. The compound's stability and reactivity can be influenced by pH and the presence of other functional groups, making it a versatile candidate for research in organic synthesis and materials science. Overall, N-(Carboxymethyl)acridone is a significant compound in both academic and industrial chemistry contexts.
Formula:C15H11NO3
InChI:InChI=1S/C15H11NO3/c17-14(18)9-16-12-7-3-1-5-10(12)15(19)11-6-2-4-8-13(11)16/h1-8H,9H2,(H,17,18)
InChI key:InChIKey=UOMKBIIXHQIERR-UHFFFAOYSA-N
SMILES:C(C(O)=O)N1C=2C(C(=O)C=3C1=CC=CC3)=CC=CC2
Synonyms:- (9-Oxo-10(9H)-acridinyl)acetic acid
- (9-oxoacridin-10(9H)-yl)acetic acid
- 10(9H)-Acridineacetic acid, 9-oxo-
- 10-(Carboxymethyl)-9-acridinone
- 10-Carboxymethylacridin-9(10H)-one
- 10-Cma
- 2-(9-Oxo-9,10-dihydroacridin-10-yl)acetic acid
- 2-(9-Oxoacridin-10-yl)acetic acid
- 9-Oxo-10-acridineacetic acid
- Acridone Acetic Acid
- Acridone-N-acetic acid
- Cridanimod
- N-(Carboxymethyl)-9-acridone
- N-(Carboxymethyl)acridone
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
9-Oxoacridine-10-acetic Acid
CAS:Formula:C15H11NO3Purity:>98.0%(T)(HPLC)Color and Shape:White to Yellow to Green powder to crystalMolecular weight:253.269-Oxo-10(9H)-acridineacetic acid
CAS:Formula:C15H11NO3Purity:%Color and Shape:SolidMolecular weight:253.25279-Oxo-10(9H)-Acridineacetic Acid
CAS:9-Oxo-10(9H)-Acridineacetic AcidPurity:98%Molecular weight:253.25g/molCridanimod
CAS:Cridanimod (10-carboxymethyl-9-acridanone, CMA) is a potent STING agonist that directly binds to STING and triggers a strong antiviral response through the TBK1Formula:C15H11NO3Purity:99.91% - 99.96%Color and Shape:SolidMolecular weight:253.259-Oxo-10(9H)-acridineacetic Acid
CAS:Applications 9-Oxo-10(9H)-acridineacetic acid is a reagent for pre-column derivatization of amino acids for fluorescent determination in HPLC and it is also a building block in pharmaceutics.
Formula:C15H11NO3Color and Shape:NeatMolecular weight:253.25(9-Oxo-9 H -acridin-10-yl)-acetic acid
CAS:Purity:98.0%Color and Shape:Solid, No data available.Molecular weight:253.25700378417979-Oxo-10(9H)-acridineacetic acid
CAS:9-Oxo-10(9H)-acridineacetic acid is an anti-viral drug that belongs to the class of acridone derivatives. It has been shown to have a redox potential of -0.15 V, which is indicative of its oxidizing properties. 9-Oxo-10(9H)-acridineacetic acid can be used as an antiviral agent against human pathogens such as HIV, hepatitis B, and hepatitis C. This drug also has activity index values of 5.6x104 and 10x105 in terms of the ability to inhibit viral polymerase chain reaction (PCR) amplification and virus infection respectively.Formula:C15H11NO3Purity:Min. 95%Color and Shape:Yellow PowderMolecular weight:253.25 g/mol







