CAS 386207-77-8
:4-chloroquinoline-6-carboxylic acid
Description:
4-Chloroquinoline-6-carboxylic acid is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a carboxylic acid group (-COOH) at the 6-position and a chlorine atom at the 4-position contributes to its chemical reactivity and potential applications. This compound typically exhibits properties such as moderate solubility in polar solvents and may show varying solubility in non-polar solvents due to its functional groups. It can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in medicinal chemistry and the development of pharmaceuticals. The chlorine substituent can influence the compound's biological activity, potentially enhancing its efficacy in certain applications. Additionally, 4-chloroquinoline-6-carboxylic acid may serve as a precursor for the synthesis of more complex molecules, contributing to its relevance in research and industrial applications. Its unique structure and functional groups make it a valuable compound in the study of quinoline derivatives and their derivatives.
Formula:C10H6ClNO2
InChI:InChI=1/C10H6ClNO2/c11-8-3-4-12-9-2-1-6(10(13)14)5-7(8)9/h1-5H,(H,13,14)
SMILES:c1cc2c(cc1C(=O)O)c(ccn2)Cl
Synonyms:- 6-Quinolinecarboxylic Acid, 4-Chloro-
- 4-Chloroquinoline-6-carboxylic acid
- 4-chloro-6-quinolinecarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Chloroquinoline-6-carboxylic acid
CAS:Formula:C10H6ClNO2Purity:98%Color and Shape:SolidMolecular weight:207.61314-Chloroquinoline-6-carboxylic acid
CAS:4-Chloroquinoline-6-carboxylic acidPurity:98%Molecular weight:207.61g/mol4-Chloroquinoline-6-carboxylicacid
CAS:Please enquire for more information about 4-Chloroquinoline-6-carboxylicacid including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C10H6ClNO2Purity:Min. 95%Molecular weight:207.61 g/mol



