CAS 386229-77-2

Sodium 3′-thymidylate 5′-(dihydrogen phosphate) (2:1)

Description:

Sodium 3′-thymidylate 5′-(dihydrogen phosphate) (2:1), with the CAS number 386229-77-2, is a nucleotide derivative that plays a crucial role in biochemistry, particularly in the synthesis of nucleic acids. This compound consists of a thymidine base linked to a phosphate group, which is essential for the formation of DNA. The "2:1" designation indicates a specific stoichiometry in its ionic form, suggesting that two sodium ions are associated with each molecule of the nucleotide. This substance is typically soluble in water, which facilitates its use in various biochemical applications, including molecular biology techniques such as PCR and DNA synthesis. Its structural characteristics include a ribose sugar, a nitrogenous base (thymine), and phosphate groups that contribute to its overall stability and reactivity. As a nucleotide, it is involved in energy transfer and serves as a building block for nucleic acids, making it vital for cellular processes such as replication and transcription.

Formula: C₁₀H₁₆N₂O₁₁P₂·2Na

InChI: InChI=1S/C10H16N2O11P2.2Na/c1-5-3-12(10(14)11-9(5)13)8-2-6(23-25(18,19)20)7(22-8)4-21-24(15,16)17;;/h3,6-8H,2,4H2,1H3,(H,11,13,14)(H2,15,16,17)(H2,18,19,20);;/t6-,7+,8+;;/m0../s1

InChI key: InChIKey=AGIHHMDKBBEVAC-ZJWYQBPBSA-N

SMILES: O=C1N([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](OP(=O)(O)O)C2)C=C(C)C(=O)N1.[Na]

Synonyms:

• 3′-Thymidylic acid, 5′-(dihydrogen phosphate), disodium salt
• 3′-Thymidylic acid, 5′-(dihydrogen phosphate), sodium salt (1:2)
• Sodium 3′-thymidylate 5′-(dihydrogen phosphate) (2:1)

Thymidine 3'',5''-diphosphate disodium salt

CAS: 386229-77-2

Ref: 7W-GN0620

Thymidine 3’,5’-Diphosphate Disodium Salt

Controlled Product

CAS: 386229-77-2

Formula: C₁₀H₁₄N₂Na₂O₁₁P₂

Color and Shape: Neat

Molecular weight: 446.15

Ref: TR-T410000

Thymidine-3',5'-diphosphate disodium salt

CAS: 386229-77-2

Thymidine-3',5'-diphosphate disodium salt is an antiviral and anticancer drug. It is a modified nucleoside which is synthesized from thymidine-3',5'-diphosphate and sodium bicarbonate (NaHCO3). This drug inhibits the synthesis of DNA and RNA, thereby inhibiting viral replication. Thymidine-3',5'-diphosphate disodium salt also has an antitumor effect by preventing the production of DNA in tumor cells.

Formula: C₁₀H₁₄N₂Na₂O₁₁P₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 446.15 g/mol

Ref: 3D-NT07359