CAS 38628-51-2
:Carboxyphenylpropionicacid; 985
Description:
Carboxyphenylpropionic acid, with the CAS number 38628-51-2, is an organic compound characterized by the presence of both carboxylic acid and phenyl groups in its structure. This compound typically exhibits properties associated with aromatic carboxylic acids, including solubility in polar solvents and moderate acidity due to the carboxyl functional group. It may participate in various chemical reactions, such as esterification and amidation, owing to its reactive carboxylic acid group. The phenyl group contributes to its stability and can influence its reactivity and interaction with other molecules. Additionally, compounds like carboxyphenylpropionic acid are often studied for their potential applications in pharmaceuticals, agrochemicals, and materials science. The specific characteristics, such as melting point, boiling point, and spectral properties, can vary based on the compound's purity and the conditions under which it is analyzed. Overall, this compound is of interest in both synthetic and applied chemistry due to its functional groups and structural features.
Formula:C10H10O4
InChI:InChI=1/C10H10O4/c11-9(12)6-3-7-1-4-8(5-2-7)10(13)14/h1-2,4-5H,3,6H2,(H,11,12)(H,13,14)
SMILES:c1cc(ccc1CCC(=O)O)C(=O)O
Synonyms:- 3-(4-Carboxyphenyl)propionic acid
- 4-(2-Carboxyethyl)Benzoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-(4-Carboxyphenyl)propionic acid, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C10H10O4Purity:98%Color and Shape:White, PowderMolecular weight:194.194-(2-Carboxyethyl)benzoic acid
CAS:Formula:C10H10O4Purity:97%Color and Shape:SolidMolecular weight:194.18403-(4-Carboxyphenyl)propionic acid
CAS:3-(4-Carboxyphenyl)propionic acidPurity:97%Molecular weight:194.18g/mol3-(4-Carboxyphenyl)propionic acid
CAS:Formula:C10H10O4Purity:97%Color and Shape:SolidMolecular weight:194.1864-(2-carboxyethyl)benzoic acid
CAS:<p>4-(2-carboxyethyl)benzoic acid is a dihedral molecule that has been shown to exhibit processability at temperatures of up to 120°C. It can be prepared by the reaction of carboxylic acids with ethylene glycol in the presence of an inorganic base such as sodium hydroxide, sodium methoxide, or potassium tert-butoxide. 4-(2-Carboxyethyl)benzoic acid has nitrogen atoms and ft-ir spectroscopic properties that are consistent with its role in hydrogen bonding interactions and fluorescence properties. This compound has also been shown to have supramolecular properties.</p>Formula:C10H10O4Purity:Min. 95%Molecular weight:194.18 g/mol3-(4-Carboxyphenyl)propionic Acid
CAS:Formula:C10H10O4Purity:>98.0%(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:194.19





